Search

name of potassium tetrathionate

Input interpretation

potassium tetrathionate
potassium tetrathionate

Chemical names and formulas

formula | KOSO_2SSSO_3K Hill formula | K_2O_6S_4 name | potassium tetrathionate mass fractions | K (potassium) 25.9% | O (oxygen) 31.7% | S (sulfur) 42.4%
formula | KOSO_2SSSO_3K Hill formula | K_2O_6S_4 name | potassium tetrathionate mass fractions | K (potassium) 25.9% | O (oxygen) 31.7% | S (sulfur) 42.4%

Structure diagram

Structure diagram
Structure diagram
vertex count | 12 edge count | 9 Schultz index | 464 Wiener index | 127 Hosoya index | 41 Balaban index | 3.563
vertex count | 12 edge count | 9 Schultz index | 464 Wiener index | 127 Hosoya index | 41 Balaban index | 3.563

Basic properties

molar mass | 302.4 g/mol density | 2.96 g/cm^3
molar mass | 302.4 g/mol density | 2.96 g/cm^3

Units

Chemical identifiers

CAS number | 13932-13-3 PubChem CID number | 61701 SMILES identifier | [O-]S(=O)(=O)SSS(=O)(=O)[O-].[K+].[K+] InChI identifier | InChI=1/2K.H2O6S4/c;;1-9(2, 3)7-8-10(4, 5)6/h;;(H, 1, 2, 3)(H, 4, 5, 6)/q2*+1;/p-2/f2K.O6S4/q2m;-2 RTECS number | XF6450000 MDL number | MFCD00079233
CAS number | 13932-13-3 PubChem CID number | 61701 SMILES identifier | [O-]S(=O)(=O)SSS(=O)(=O)[O-].[K+].[K+] InChI identifier | InChI=1/2K.H2O6S4/c;;1-9(2, 3)7-8-10(4, 5)6/h;;(H, 1, 2, 3)(H, 4, 5, 6)/q2*+1;/p-2/f2K.O6S4/q2m;-2 RTECS number | XF6450000 MDL number | MFCD00079233

Random Queries

ion class of scandium(III) cation vs iron(III) cation
non-standard isotope tally of beryllium vs titanium(IV) oxysulfate
structure diagram of francium cation
formula of europium(III) acetate hydrate
net ionic charge of yttrium(II) cation vs iron(III) cation
atomic number of fluorine vs iodine
shear modulus of group 13 elements
alternate names of aluminum chloride vs nickel(II) chloride
H2O + Al(NO3)3 = HNO3 + Al(OH)3
stable isotopes of potassium