Search

(3,5-difluorophenylethynyl)trimethylsilane

Input interpretation

(3, 5-difluorophenylethynyl)trimethylsilane
(3, 5-difluorophenylethynyl)trimethylsilane

Chemical names and formulas

formula | (CH_3)_3SiC congruent CC_6H_3F_2 Hill formula | C_11H_12F_2Si name | (3, 5-difluorophenylethynyl)trimethylsilane IUPAC name | 2-(3, 5-difluorophenyl)ethynyl-trimethylsilane alternate names | 2-(3, 5-difluorophenyl)ethynyl-trimethyl-silane | 2-(3, 5-difluorophenyl)ethynyl-trimethylsilane mass fractions | C (carbon) 62.8% | F (fluorine) 18.1% | H (hydrogen) 5.75% | Si (silicon) 13.4%
formula | (CH_3)_3SiC congruent CC_6H_3F_2 Hill formula | C_11H_12F_2Si name | (3, 5-difluorophenylethynyl)trimethylsilane IUPAC name | 2-(3, 5-difluorophenyl)ethynyl-trimethylsilane alternate names | 2-(3, 5-difluorophenyl)ethynyl-trimethyl-silane | 2-(3, 5-difluorophenyl)ethynyl-trimethylsilane mass fractions | C (carbon) 62.8% | F (fluorine) 18.1% | H (hydrogen) 5.75% | Si (silicon) 13.4%

Lewis structure

Draw the Lewis structure of (3, 5-difluorophenylethynyl)trimethylsilane. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and silicon (n_Si, val = 4) atoms: 11 n_C, val + 2 n_F, val + 12 n_H, val + n_Si, val = 74 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and silicon (n_Si, full = 8): 11 n_C, full + 2 n_F, full + 12 n_H, full + n_Si, full = 136 Subtracting these two numbers shows that 136 - 74 = 62 bonding electrons are needed. Each bond has two electrons, so in addition to the 26 bonds already present in the diagram add 5 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
Draw the Lewis structure of (3, 5-difluorophenylethynyl)trimethylsilane. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and silicon (n_Si, val = 4) atoms: 11 n_C, val + 2 n_F, val + 12 n_H, val + n_Si, val = 74 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and silicon (n_Si, full = 8): 11 n_C, full + 2 n_F, full + 12 n_H, full + n_Si, full = 136 Subtracting these two numbers shows that 136 - 74 = 62 bonding electrons are needed. Each bond has two electrons, so in addition to the 26 bonds already present in the diagram add 5 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

3D structure

3D structure
3D structure

Basic properties

molar mass | 210.3 g/mol phase | liquid (at STP) boiling point | 200.5 °C density | 0.995 g/cm^3
molar mass | 210.3 g/mol phase | liquid (at STP) boiling point | 200.5 °C density | 0.995 g/cm^3

Units

Liquid properties (at STP)

density | 0.995 g/cm^3 refractive index | 1.492
density | 0.995 g/cm^3 refractive index | 1.492

Units

Chemical identifiers

CAS number | 445491-09-8 PubChem CID number | 4464151 PubChem SID number | 24881238 SMILES identifier | C[Si](C)(C)C#CC1=CC(=CC(=C1)F)F InChI identifier | InChI=1/C11H12F2Si/c1-14(2, 3)5-4-9-6-10(12)8-11(13)7-9/h6-8H, 1-3H3 MDL number | MFCD04039981
CAS number | 445491-09-8 PubChem CID number | 4464151 PubChem SID number | 24881238 SMILES identifier | C[Si](C)(C)C#CC1=CC(=CC(=C1)F)F InChI identifier | InChI=1/C11H12F2Si/c1-14(2, 3)5-4-9-6-10(12)8-11(13)7-9/h6-8H, 1-3H3 MDL number | MFCD04039981

Safety properties

flash point | 75 °C
flash point | 75 °C

Random Queries

crystal class of ceruléite
alternate names of niobium(III) cation
H2SO4 + Ba(OH)2 = H2O + BaSO4
name of titanium
alternate names of 2,6-dimethyl-5-heptenal
crystal class of svyatoslavite
odor of phosphoric acid vs water
formula of aluminum cation vs boron(III) cation
net ionic charge of hydrogen phosphite anion vs arsenic(V) cation
atomic number of group 11 elements