Input interpretation
(3, 5-difluorophenylethynyl)trimethylsilane
Chemical names and formulas
formula | (CH_3)_3SiC congruent CC_6H_3F_2 Hill formula | C_11H_12F_2Si name | (3, 5-difluorophenylethynyl)trimethylsilane IUPAC name | 2-(3, 5-difluorophenyl)ethynyl-trimethylsilane alternate names | 2-(3, 5-difluorophenyl)ethynyl-trimethyl-silane | 2-(3, 5-difluorophenyl)ethynyl-trimethylsilane mass fractions | C (carbon) 62.8% | F (fluorine) 18.1% | H (hydrogen) 5.75% | Si (silicon) 13.4%
Lewis structure
Draw the Lewis structure of (3, 5-difluorophenylethynyl)trimethylsilane. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and silicon (n_Si, val = 4) atoms: 11 n_C, val + 2 n_F, val + 12 n_H, val + n_Si, val = 74 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and silicon (n_Si, full = 8): 11 n_C, full + 2 n_F, full + 12 n_H, full + n_Si, full = 136 Subtracting these two numbers shows that 136 - 74 = 62 bonding electrons are needed. Each bond has two electrons, so in addition to the 26 bonds already present in the diagram add 5 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 210.3 g/mol phase | liquid (at STP) boiling point | 200.5 °C density | 0.995 g/cm^3
Units
Liquid properties (at STP)
density | 0.995 g/cm^3 refractive index | 1.492
Units
Chemical identifiers
(C)C#CC1=CC(=CC(=C1)F)F InChI identifier | InChI=1/C11H12F2Si/c1-14(2, 3)5-4-9-6-10(12)8-11(13)7-9/h6-8H, 1-3H3 MDL number | MFCD04039981](../image_source/3e6671f02d29eefdef46381f097b40ab.png)
CAS number | 445491-09-8 PubChem CID number | 4464151 PubChem SID number | 24881238 SMILES identifier | C[Si](C)(C)C#CC1=CC(=CC(=C1)F)F InChI identifier | InChI=1/C11H12F2Si/c1-14(2, 3)5-4-9-6-10(12)8-11(13)7-9/h6-8H, 1-3H3 MDL number | MFCD04039981
Safety properties
flash point | 75 °C