Input interpretation
sodium bromate | potassium permanganate
Chemical names and formulas
| sodium bromate | potassium permanganate formula | NaBrO_3 | KMnO_4 Hill formula | BrNaO_3 | KMnO_4 name | sodium bromate | potassium permanganate IUPAC name | sodium bromate | potassium permanganate alternate names | DOT | dyetone | cairox | chameleon mineral | condy's crystals | permanganate of potash | potassium manganate(VII) | potassium permanganate(VII) mass fractions | Br (bromine) 53% | Na (sodium) 15.2% | O (oxygen) 31.8% | K (potassium) 24.7% | Mn (manganese) 34.8% | O (oxygen) 40.5%
Structure diagrams
| sodium bromate | potassium permanganate vertex count | 5 | 6 edge count | 3 | 4 Schultz index | 36 | 64 Wiener index | 9 | 16 Hosoya index | 4 | 5 Balaban index | 2.324 | 3.024
Basic properties
| sodium bromate | potassium permanganate molar mass | 150.89 g/mol | 158.03 g/mol phase | solid (at STP) | solid (at STP) melting point | 381 °C | 240 °C boiling point | 1390 °C | density | 3.339 g/cm^3 | 1 g/cm^3 solubility in water | soluble |
Units
Solid properties (at STP)
| sodium bromate | potassium permanganate density | 3.339 g/cm^3 | 1 g/cm^3 vapor pressure | | 0.075 mmHg
Units
Chemical identifiers
| sodium bromate | potassium permanganate CAS number | 7789-38-0 | 7722-64-7 PubChem CID number | 23668195 | 516875 PubChem SID number | 24853461 | 24859164 SMILES identifier | [O-]Br(=O)=O.[Na+] | [O-][Mn](=O)(=O)=O.[K+] InChI identifier | InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m | InChI=1/K.Mn.4O/q+1;;;;;-1/rK.MnO4/c;2-1(3, 4)5/q+1;-1 RTECS number | EF8750000 | SD6475000 MDL number | MFCD00003476 | MFCD00011364
NFPA label
NFPA label
| sodium bromate | potassium permanganate NFPA health rating | | 3 NFPA fire rating | | 3 NFPA reactivity rating | | 0 NFPA hazards | oxidizing agent | oxidizing agent
Safety properties
| sodium bromate flash point | 381 °C
| sodium bromate | potassium permanganate DOT hazard class | 5.1 | 5.1 DOT numbers | 1494 | 1490