Input interpretation
1, 2-difluorobenzene | 1H, 1H-perfluorooctylamine
Chemical names and formulas
| 1, 2-difluorobenzene | 1H, 1H-perfluorooctylamine formula | C_6H_4F_2 | C_8H_4F_15N Hill formula | C_6H_4F_2 | C_8H_4F_15N name | 1, 2-difluorobenzene | 1H, 1H-perfluorooctylamine IUPAC name | 1, 2-difluorobenzene | 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 8-pentadecafluorooctan-1-amine alternate names | benzene, 1, 2-difluoro- | benzene, o-difluoro- | o-difluorobenzene | ortho-difluorobenzene | 1H, 1H-pentadecafluorooctylamine mass fractions | C (carbon) 63.2% | F (fluorine) 33.3% | H (hydrogen) 3.53% | C (carbon) 24.1% | F (fluorine) 71.4% | H (hydrogen) 1.01% | N (nitrogen) 3.51%
Structure diagrams
| 1, 2-difluorobenzene | 1H, 1H-perfluorooctylamine vertex count | 8 | 24 edge count | 8 | 25 Schultz index | 264 | 4048 Wiener index | 60 | 1117 Hosoya index | 39 | 11781 Balaban index | 2.279 | 6.417
3D structure
3D structure
Basic properties
| 1, 2-difluorobenzene | 1H, 1H-perfluorooctylamine molar mass | 114.09 g/mol | 399.1 g/mol phase | liquid (at STP) | liquid (at STP) melting point | -34 °C | boiling point | 92 °C | 150 °C density | 1.158 g/cm^3 | 1.714 g/cm^3 solubility in water | slightly soluble |
Units
Liquid properties
| 1, 2-difluorobenzene | 1H, 1H-perfluorooctylamine density | 1.158 g/cm^3 | 1.714 g/cm^3 vapor pressure | 57 mmHg | refractive index | 1.443 | 1.3092
Units
Thermodynamic properties
| 1, 2-difluorobenzene molar heat of vaporization | 32.2 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.282 kJ/g (kilojoules per gram) molar heat of fusion | 11.05 kJ/mol (kilojoules per mole) critical temperature | 566 K (kelvins)
Chemical identifiers
| 1, 2-difluorobenzene | 1H, 1H-perfluorooctylamine CAS number | 367-11-3 | 307-29-9 Beilstein number | 1905113 | 1806966 PubChem CID number | 9706 | 136148 PubChem SID number | 24847704 | SMILES identifier | C1=CC=C(C(=C1)F)F | C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)N
NFPA label
NFPA label
Safety properties
| 1, 2-difluorobenzene flash point | 2.222 °C