Search

SMILES identifier of mercury(II) nitrate

Input interpretation

mercury(II) nitrate | SMILES identifier
mercury(II) nitrate | SMILES identifier

Result

[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Hg+2]
[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Hg+2]

Random Queries

apply total variation filter image ganophyllite
name of epistolite vs sanbornite
mass magnetic susceptibility of lead
nitric acid vs perchloric acid
boiling point of liquid elements
molar mass of samarium(III) bromate nonahydrate
molar mass of cupric sulfide vs dilithium tetrabromonickelate(II)
formula of yttrium carbide vs propargyl acrylate
IUPAC name of L-tryptophan
melting point of selenium trioxide