Input interpretation
(Z)-2-(chloroacetamido)-alpha-(methoxyimino)thiazol-4-acetic acid
Chemical names and formulas
![formula | C_8H_8ClN_3O_4S name | (Z)-2-(chloroacetamido)-alpha-(methoxyimino)thiazol-4-acetic acid IUPAC name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1, 3-thiazol-4-yl]-2-methoxyimino-acetic acid mass fractions | C (carbon) 34.6% | Cl (chlorine) 12.8% | H (hydrogen) 2.9% | N (nitrogen) 15.1% | O (oxygen) 23% | S (sulfur) 11.5%](../image_source/e9f4acc8f5ade5b0b5cd0f8d2560f61e.png)
formula | C_8H_8ClN_3O_4S name | (Z)-2-(chloroacetamido)-alpha-(methoxyimino)thiazol-4-acetic acid IUPAC name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1, 3-thiazol-4-yl]-2-methoxyimino-acetic acid mass fractions | C (carbon) 34.6% | Cl (chlorine) 12.8% | H (hydrogen) 2.9% | N (nitrogen) 15.1% | O (oxygen) 23% | S (sulfur) 11.5%
Lewis structure
Draw the Lewis structure of (Z)-2-(chloroacetamido)-alpha-(methoxyimino)thiazol-4-acetic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), oxygen (n_O, val = 6), and sulfur (n_S, val = 6) atoms: 8 n_C, val + n_Cl, val + 8 n_H, val + 3 n_N, val + 4 n_O, val + n_S, val = 92 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), oxygen (n_O, full = 8), and sulfur (n_S, full = 8): 8 n_C, full + n_Cl, full + 8 n_H, full + 3 n_N, full + 4 n_O, full + n_S, full = 152 Subtracting these two numbers shows that 152 - 92 = 60 bonding electrons are needed. Each bond has two electrons, so in addition to the 25 bonds already present in the diagram add 5 bonds. To minimize formal charge oxygen wants 2 bonds, nitrogen wants 3 bonds, and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 277.7 g/mol phase | solid (at STP) melting point | 183 °C solubility in water | very soluble
Units
Chemical identifiers
CAS number | 64486-18-6 Beilstein number | 545061 PubChem CID number | 5858790 SMILES identifier | CON=C(C1=CSC(=N1)NC(=O)CCl)C(=O)O InChI identifier | InChI=1/C8H8ClN3O4S/c1-16-12-6(7(14)15)4-3-17-8(10-4)11-5(13)2-9/h3H, 2H2, 1H3, (H, 14, 15)(H, 10, 11, 13)/b12-6-/f/h11, 14H EU number | 264-916-4