Search

isomeric SMILES identifier of phenethylmagnesium chloride

Input interpretation

phenethylmagnesium chloride | isomeric SMILES identifier
phenethylmagnesium chloride | isomeric SMILES identifier

Result

[CH2-]CC1=CC=CC=C1.[Mg+2].[Cl-]
[CH2-]CC1=CC=CC=C1.[Mg+2].[Cl-]

Random Queries

molar mass of cesium orthovanadate
melting point of sodium amide vs calcium hydroxide
common compound names of thallium vs cesium
NH3 = H2 + N2
ion class of triflate anion
refractive indices of paceite
neutron number of Ge-85 vs Cs-145
chemical functional groups of (S)-(-)-2-(tert-butoxycarbonylamino)-3-cyclohexyl-1-propanol
H2SO4 + KMnO4 + FeCl2 = H2O + K2SO4 + MnSO4 + Fe2(SO4)3 + HOCl2
flash point of dactinomycin