Input interpretation
![trichloro(cyclohexylmethyl)silane](../image_source/9fd6d20b45df166d9dca83fdf6405236.png)
trichloro(cyclohexylmethyl)silane
Chemical names and formulas
![formula | C_7H_13Cl_3Si name | trichloro(cyclohexylmethyl)silane IUPAC name | trichloro-(cyclohexylmethyl)silane alternate names | (cyclohexylmethyl)trichlorosilane mass fractions | C (carbon) 36.3% | Cl (chlorine) 45.9% | H (hydrogen) 5.66% | Si (silicon) 12.1%](../image_source/1e23ced5de8fc4a8bfdf75e835e09723.png)
formula | C_7H_13Cl_3Si name | trichloro(cyclohexylmethyl)silane IUPAC name | trichloro-(cyclohexylmethyl)silane alternate names | (cyclohexylmethyl)trichlorosilane mass fractions | C (carbon) 36.3% | Cl (chlorine) 45.9% | H (hydrogen) 5.66% | Si (silicon) 12.1%
Lewis structure
![Draw the Lewis structure of trichloro(cyclohexylmethyl)silane. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and silicon (n_Si, val = 4) atoms: 7 n_C, val + 3 n_Cl, val + 13 n_H, val + n_Si, val = 66 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and silicon (n_Si, full = 8): 7 n_C, full + 3 n_Cl, full + 13 n_H, full + n_Si, full = 114 Subtracting these two numbers shows that 114 - 66 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 66 - 48 = 18 electrons left to draw: Answer: | |](../image_source/40cdcf5e19670788904d33ce53374bdf.png)
Draw the Lewis structure of trichloro(cyclohexylmethyl)silane. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and silicon (n_Si, val = 4) atoms: 7 n_C, val + 3 n_Cl, val + 13 n_H, val + n_Si, val = 66 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and silicon (n_Si, full = 8): 7 n_C, full + 3 n_Cl, full + 13 n_H, full + n_Si, full = 114 Subtracting these two numbers shows that 114 - 66 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 66 - 48 = 18 electrons left to draw: Answer: | |
3D structure
![3D structure](../image_source/9088bea9e55b778b50037aa261620c8b.png)
3D structure
Basic properties
![molar mass | 231.6 g/mol phase | liquid (at STP) boiling point | 108.5 °C (measured at 3300 Pa) density | 1.1954 g/cm^3](../image_source/6bbe0f5363a52affbc6c87a5dc15019d.png)
molar mass | 231.6 g/mol phase | liquid (at STP) boiling point | 108.5 °C (measured at 3300 Pa) density | 1.1954 g/cm^3
Units
Liquid properties (at STP)
![density | 1.1954 g/cm^3 refractive index | 1.4759](../image_source/8bbbcde555ea5f57b2ca1e07b94c44c8.png)
density | 1.1954 g/cm^3 refractive index | 1.4759
Units
Chemical identifiers
![CAS number | 18388-16-4 Beilstein number | 2935348 PubChem CID number | 87618 SMILES identifier | C1CCC(CC1)C[Si](Cl)(Cl)Cl InChI identifier | InChI=1/C7H13Cl3Si/c8-11(9, 10)6-7-4-2-1-3-5-7/h7H, 1-6H2 EU number | 242-265-7](../image_source/7e937f538169b8be05c0c9508db60ea1.png)
CAS number | 18388-16-4 Beilstein number | 2935348 PubChem CID number | 87618 SMILES identifier | C1CCC(CC1)C[Si](Cl)(Cl)Cl InChI identifier | InChI=1/C7H13Cl3Si/c8-11(9, 10)6-7-4-2-1-3-5-7/h7H, 1-6H2 EU number | 242-265-7