Input interpretation
1-vinylnaphthalene | 2, 5-dimethyl-2-hexene
Chemical names and formulas
| 1-vinylnaphthalene | 2, 5-dimethyl-2-hexene formula | C_10H_7CH=CH_2 | C_8H_16 Hill formula | C_12H_10 | C_8H_16 name | 1-vinylnaphthalene | 2, 5-dimethyl-2-hexene IUPAC name | 1-vinylnaphthalene | 2, 5-dimethylhex-2-ene alternate names | 1-ethenylnaphthalene | a-vinylnaphthalene | naphthalene, 1-ethenyl- | 2, 5-dimethylhex-2-ene mass fractions | C (carbon) 93.5% | H (hydrogen) 6.54% | C (carbon) 85.6% | H (hydrogen) 14.4%
Structure diagrams
| 1-vinylnaphthalene | 2, 5-dimethyl-2-hexene vertex count | 12 | 8 edge count | 13 | 7 Schultz index | 816 | 270 Wiener index | 182 | 74 Hosoya index | 366 | 25 Balaban index | 1.987 | 2.928
3D structure
3D structure
Basic properties
| 1-vinylnaphthalene | 2, 5-dimethyl-2-hexene molar mass | 154.21 g/mol | 112.22 g/mol phase | liquid (at STP) | liquid (at STP) melting point | 21 °C | boiling point | 136.5 °C | 112 °C density | 1.04 g/cm^3 | 0.7182 g/cm^3 solubility in water | insoluble | insoluble
Units
Liquid properties
| 1-vinylnaphthalene | 2, 5-dimethyl-2-hexene density | 1.04 g/cm^3 | 0.7182 g/cm^3 vapor pressure | 0.01 mmHg | refractive index | 1.653 | 1.414
Units
Thermodynamic properties
| 1-vinylnaphthalene molar heat of vaporization | 48.9 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.3171 kJ/g (kilojoules per gram)
Chemical identifiers
| 1-vinylnaphthalene | 2, 5-dimethyl-2-hexene CAS number | 826-74-4 | 3404-78-2 Beilstein number | | 1732130 PubChem CID number | 70004 | 18853 PubChem SID number | 24877761 | SMILES identifier | C=CC1=CC=CC2=CC=CC=C21 | CC(C)CC=C(C)C InChI identifier | InChI=1/C12H10/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h2-9H, 1H2 | InChI=1/C8H16/c1-7(2)5-6-8(3)4/h5, 8H, 6H2, 1-4H3 NSC number | | 74164 MDL number | MFCD00075766 |
NFPA label
NFPA label
| 1-vinylnaphthalene NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 1