Input interpretation
boric acid
Chemical names and formulas
formula | B(OH)_3 Hill formula | BH_3O_3 name | boric acid alternate names | boracic acid | orthoboric acid mass fractions | B (boron) 17.5% | H (hydrogen) 4.89% | O (oxygen) 77.6%
Lewis structure
Draw the Lewis structure of boric acid. Start by drawing the overall structure of the molecule: Count the total valence electrons of the boron (n_B, val = 3), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_B, val + 3 n_H, val + 3 n_O, val = 24 Calculate the number of electrons needed to completely fill the valence shells for boron (n_B, full = 6), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_B, full + 3 n_H, full + 3 n_O, full = 36 Subtracting these two numbers shows that 36 - 24 = 12 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 6 bonds and hence 12 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 24 - 12 = 12 electrons left to draw: Answer: | |
Basic properties
molar mass | 61.83 g/mol phase | solid (at STP) melting point | 160 °C
Units
Solid properties (at STP)
vapor pressure | 2.6 mmHg
Units
Thermodynamic properties
specific heat capacity c_p | solid | 1.393 J/(g K) molar heat capacity c_p | solid | 86.1 J/(mol K) specific free energy of formation Δ_fG° | solid | -15.67 kJ/g molar free energy of formation Δ_fG° | solid | -968.9 kJ/mol specific heat of formation Δ_fH° | gas | -16.08 kJ/g | solid | -17.7 kJ/g molar heat of formation Δ_fH° | gas | -994.1 kJ/mol | solid | -1094 kJ/mol molar heat of fusion | 22.3 kJ/mol | specific heat of fusion | 0.361 kJ/g | (at STP)
Chemical identifiers
CAS number | 10043-35-3 PubChem CID number | 7628 PubChem SID number | 24852125 SMILES identifier | B(O)(O)O InChI identifier | InChI=1/BH3O3/c2-1(3)4/h2-4H RTECS number | ED4550000 MDL number | MFCD00011337
Toxicity properties
odor | odorless