Input interpretation
propidium
Chemical names and formulas
formula | C_27H_34N_4 name | propidium IUPAC name | 3-(3, 8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-diethyl-methylazanium diiodide mass fractions | C (carbon) 78.2% | H (hydrogen) 8.27% | N (nitrogen) 13.5%
Lewis structure
Draw the Lewis structure of propidium. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and nitrogen (n_N, val = 5) atoms, including the net charge: 27 n_C, val + 34 n_H, val + 4 n_N, val - n_charge = 160 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and nitrogen (n_N, full = 8): 27 n_C, full + 34 n_H, full + 4 n_N, full = 316 Subtracting these two numbers shows that 316 - 160 = 156 bonding electrons are needed. Each bond has two electrons, so in addition to the 68 bonds already present in the diagram add 10 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom. The net charge has been taken from the least electronegative atom, nitrogen, in 2 places: To fully fill its valence shell, nitrogen will donate one of its electrons, allowing it to form four bonds. Fill in the 10 bonds by pairing electrons between adjacent highlighted atoms, noting the formal charges of the atoms: Answer: | |
Basic properties
molar mass | 414.6 g/mol phase | solid (at STP)
Units
Hydrophobicity and permeability properties
predicted LogP hydrophobicity | 1.56 predicted LogS | -8.83
Basic drug properties
approval status | experimental | small molecule drug categories | acetylcholinesterase inhibitor | coloring agent | indicators and reagent | intercalating agent
Chemical identifiers
(CC)CCC[N+]1=C(C2=CC=CC=C2)C2=C(C=CC(N)=C2)C2=C1C=C(N)C=C2 InChI identifier | InChI=1/C27H33N4/c1-4-31(3, 5-2)17-9-16-30-26-19-22(29)13-15-24(26)23-14-12-21(28)18-25(23)27(30)20-10-7-6-8-11-20/h6-8, 10-15, 18-19, 29H, 4-5, 9, 16-17, 28H2, 1-3H3/q+1/p+1/fC27H34N4/h29H/q+2 InChI key | ZDWVWKDAWBGPDN-RXFFIJQVCT](../image_source/cc3b061a3d04ee624c32502069c83352.png)
CAS number | 36015-30-2 PubChem CID number | 104981 PubChem SID number | 10233709 SMILES identifier | CC[N+](C)(CC)CCC[N+]1=C(C2=CC=CC=C2)C2=C(C=CC(N)=C2)C2=C1C=C(N)C=C2 InChI identifier | InChI=1/C27H33N4/c1-4-31(3, 5-2)17-9-16-30-26-19-22(29)13-15-24(26)23-14-12-21(28)18-25(23)27(30)20-10-7-6-8-11-20/h6-8, 10-15, 18-19, 29H, 4-5, 9, 16-17, 28H2, 1-3H3/q+1/p+1/fC27H34N4/h29H/q+2 InChI key | ZDWVWKDAWBGPDN-RXFFIJQVCT