Input interpretation
N-propanol | 1-methoxy-2-propanol
Chemical names and formulas
| N-propanol | 1-methoxy-2-propanol formula | CH_3CH_2CH_2OH | CH_3CH(OH)CH_2OCH_3 Hill formula | C_3H_8O | C_4H_10O_2 name | N-propanol | 1-methoxy-2-propanol IUPAC name | propan-1-ol | 1-methoxypropan-2-ol alternate names | 1-hydroxypropane | 1-propanol | N-propyl alcohol | propan-1-ol | propanol | propyl alcohol | 1-methoxypropan-2-ol | DOWANOL®PM | propylene glycol methyl ether | propyleneglycol monomethyl ether mass fractions | C (carbon) 60% | H (hydrogen) 13.4% | O (oxygen) 26.6% | C (carbon) 53.3% | H (hydrogen) 11.2% | O (oxygen) 35.5%
Structure diagrams
| N-propanol | 1-methoxy-2-propanol vertex count | 4 | 6 edge count | 4 | 6 Schultz index | 38 | 118 Wiener index | 10 | 32 Hosoya index | 5 | 11 Balaban index | 1.975 | 2.627
3D structure
3D structure
Basic properties
| N-propanol | 1-methoxy-2-propanol molar mass | 60.1 g/mol | 90.12 g/mol phase | liquid (at STP) | liquid (at STP) melting point | -127 °C | -97 °C boiling point | 97 °C | 118.5 °C density | 0.804 g/cm^3 | 0.922 g/cm^3 solubility in water | miscible |
Units
Hydrophobicity and permeability properties
| N-propanol predicted LogP hydrophobicity | 0.21 predicted LogS | 0.81
Liquid properties
| N-propanol | 1-methoxy-2-propanol density | 0.804 g/cm^3 | 0.922 g/cm^3 vapor pressure | 9.998 mmHg | 10.9 mmHg dynamic viscosity | 0.001945 Pa s | surface tension | 0.02375 N/m | sound speed | 4403 km/h | refractive index | 1.384 | 1.403 UV cutoff wavelength | 210 nm |
Units
Thermodynamic properties
| N-propanol | 1-methoxy-2-propanol molar heat of vaporization | 47.5 kJ/mol (kilojoules per mole) | specific heat of vaporization | 0.79 kJ/g (kilojoules per gram) | molar heat of combustion | 2021.3 kJ/mol (kilojoules per mole) | molar heat of fusion | 5.37 kJ/mol (kilojoules per mole) | critical temperature | 536 K (kelvins) | 579.8 K (kelvins) critical pressure | 5.2 MPa (megapascals) | 4.113 MPa (megapascals) compressibility factor | 0.2525 (at critical conditions) | acentric factor ω | 0.628 | Antoine equation constants | 15.2175 | 3008.31 | -86.4909 |
Chemical identifiers
| N-propanol | 1-methoxy-2-propanol CAS number | 71-23-8 | 107-98-2 Beilstein number | 1098242 | 1731270 PubChem CID number | 1031 | 7900 PubChem SID number | 24855524 | 24871948 SMILES identifier | CCCO | CC(COC)O InChI identifier | InChI=1/C3H8O/c1-2-3-4/h4H, 2-3H2, 1H3 | InChI=1/C4H10O2/c1-4(5)3-6-2/h4-5H, 3H2, 1-2H3 InChI key | BDERNNFJNOPAEC-UHFFFAOYAO | RTECS number | UH8225000 | UB7700000 MDL number | MFCD00002941 | MFCD00004537
NFPA label
NFPA label
| N-propanol NFPA health rating | 1 NFPA fire rating | 3 NFPA reactivity rating | 0
Safety properties
| N-propanol | 1-methoxy-2-propanol flash point | 15 °C | 33.89 °C autoignition point | 412 °C | lower explosive limit | 2.3% | upper explosive limit | 13.57% |