Input interpretation
(4-amino-2-chloro-5-methylphenyl)(4-chlorophenyl)acetonitrile
Chemical names and formulas
formula | C_15H_12Cl_2N_2 name | (4-amino-2-chloro-5-methylphenyl)(4-chlorophenyl)acetonitrile IUPAC name | (2R)-2-(4-amino-2-chloro-5-methyl-phenyl)-2-(4-chlorophenyl)acetonitrile mass fractions | C (carbon) 61.9% | Cl (chlorine) 24.3% | H (hydrogen) 4.15% | N (nitrogen) 9.62%
Lewis structure
Draw the Lewis structure of (4-amino-2-chloro-5-methylphenyl)(4-chlorophenyl)acetonitrile. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and nitrogen (n_N, val = 5) atoms: 15 n_C, val + 2 n_Cl, val + 12 n_H, val + 2 n_N, val = 96 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and nitrogen (n_N, full = 8): 15 n_C, full + 2 n_Cl, full + 12 n_H, full + 2 n_N, full = 176 Subtracting these two numbers shows that 176 - 96 = 80 bonding electrons are needed. Each bond has two electrons, so in addition to the 32 bonds already present in the diagram add 8 bonds. To minimize formal charge nitrogen wants 3 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 8 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 291.2 g/mol phase | solid (at STP) melting point | 150 °C boiling point | 425 °C
Units
Chemical identifiers
CAS number | 61437-85-2 PubChem CID number | 736101 SMILES identifier | CC1=CC(=C(C=C1N)Cl)C(C#N)C2=CC=C(C=C2)Cl InChI identifier | InChI=1/C15H12Cl2N2/c1-9-6-12(14(17)7-15(9)19)13(8-18)10-2-4-11(16)5-3-10/h2-7, 13H, 19H2, 1H3/t13-/m1/s1 EU number | 262-792-6
Safety properties
flash point | 570 °C