Input interpretation
oleoyl chloride
Chemical names and formulas
formula | CH_3(CH_2)_7CH=CH(CH_2)_7COCl Hill formula | C_18H_33ClO name | oleoyl chloride IUPAC name | (Z)-octadec-9-enoyl chloride alternate names | oleic acid chloride | (Z)-9-octadecenoyl chloride | (Z)-octadec-9-enoyl chloride mass fractions | C (carbon) 71.8% | Cl (chlorine) 11.8% | H (hydrogen) 11.1% | O (oxygen) 5.32%
Lewis structure
Draw the Lewis structure of oleoyl chloride. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 18 n_C, val + n_Cl, val + 33 n_H, val + n_O, val = 118 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 18 n_C, full + n_Cl, full + 33 n_H, full + n_O, full = 226 Subtracting these two numbers shows that 226 - 118 = 108 bonding electrons are needed. Each bond has two electrons, so in addition to the 52 bonds already present in the diagram add 2 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 2 bonds by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 300.91 g/mol phase | liquid (at STP) melting point | -46 °C boiling point | 193 °C (measured at 533.2 Pa) density | 0.91 g/cm^3 solubility in water | decomposes
Units
Liquid properties (at STP)
density | 0.91 g/cm^3 vapor pressure | 6×10^-6 mmHg (at 25 °C) refractive index | 1.463
Units
Thermodynamic properties
molar heat of vaporization | 62.6 kJ/mol specific heat of vaporization | 0.208 kJ/g (at STP)
Chemical identifiers
CAS number | 112-77-6 Beilstein number | 1211748 PubChem CID number | 5364783 PubChem SID number | 24862853 SMILES identifier | CCCCCCCCC=CCCCCCCCC(=O)Cl InChI identifier | InChI=1/C18H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H, 2-8, 11-17H2, 1H3/b10-9- MDL number | MFCD00134332
NFPA label
NFPA label
NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 0
Safety properties
flash point | 110 °C autoignition point | 230 °C
DOT numbers | 3265