Input interpretation
manganese carbonate
Chemical names and formulas
formula | MnCO_3 Hill formula | CMnO_3 name | manganese carbonate IUPAC name | manganous carbonate alternate names | manganese(2+) carbonate | manganese(+2) cation carbonate | manganese carbonate(1:1) | manganese(II) carbonate | manganous carbonate mass fractions | C (carbon) 10.4% | Mn (manganese) 47.8% | O (oxygen) 41.8%
Structure diagram
Structure diagram
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
Basic properties
molar mass | 114.95 g/mol density | 3.12 g/cm^3 solubility in water | insoluble
Units
Thermodynamic properties
specific heat capacity c_p | solid | 0.709 J/(g K) molar heat capacity c_p | solid | 81.5 J/(mol K) specific free energy of formation Δ_fG° | solid | -7.105 kJ/g molar free energy of formation Δ_fG° | solid | -816.7 kJ/mol specific heat of formation Δ_fH° | solid | -7.778 kJ/g molar heat of formation Δ_fH° | solid | -894.1 kJ/mol (at STP)
Chemical identifiers
![CAS number | 598-62-9 PubChem CID number | 11726 PubChem SID number | 24863505 SMILES identifier | C(=O)([O-])[O-].[Mn+2] InChI identifier | InChI=1/CH2O3.Mn/c2-1(3)4;/h(H2, 2, 3, 4);/q;+2/p-2/fCO3.Mn/q-2;m MDL number | MFCD00011116](../image_source/2db1e71a835d134424fc2e28af073b96.png)
CAS number | 598-62-9 PubChem CID number | 11726 PubChem SID number | 24863505 SMILES identifier | C(=O)([O-])[O-].[Mn+2] InChI identifier | InChI=1/CH2O3.Mn/c2-1(3)4;/h(H2, 2, 3, 4);/q;+2/p-2/fCO3.Mn/q-2;m MDL number | MFCD00011116
Ion equivalents
Mn^(2+) (manganese(II) cation) | 1 (CO_3)^(2-) (carbonate anion) | 1