Input interpretation
diethyl phosphite
Chemical names and formulas
formula | (C_2H_5O)_2P(O)H Hill formula | C_4H_11O_3P name | diethyl phosphite IUPAC name | diethoxy-oxophosphonium alternate names | diethoxy-keto-phosphonium | diethoxy-oxo-phosphanium | diethoxy-oxophosphanium | diethoxy-oxo-phosphonium | diethyl acid phosphite | diethyl hydrogen phosphite | diethyl phosphonate | hydrogen diethyl phosphite mass fractions | C (carbon) 34.8% | H (hydrogen) 8.03% | O (oxygen) 34.8% | P (phosphorus) 22.4%
Lewis structure
Draw the Lewis structure of diethyl phosphite. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), oxygen (n_O, val = 6), and phosphorus (n_P, val = 5) atoms: 4 n_C, val + 11 n_H, val + 3 n_O, val + n_P, val = 50 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), oxygen (n_O, full = 8), and phosphorus (n_P, full = 8): 4 n_C, full + 11 n_H, full + 3 n_O, full + n_P, full = 86 Subtracting these two numbers shows that 86 - 50 = 36 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 18 bonds and hence 36 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 50 - 36 = 14 electrons left to draw: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 138.1 g/mol phase | liquid (at STP) boiling point | 50.5 °C (measured at 266.6 Pa) density | 1.072 g/cm^3 solubility in water | soluble
Units
Hydrophobicity and permeability properties
predicted LogP hydrophobicity | -0.01 predicted LogS | -0.34
Basic drug properties
approval status | experimental | small molecule
Liquid properties (at STP)
density | 1.072 g/cm^3 vapor pressure | 2 mmHg surface tension | 0.03079 N/m refractive index | 1.407
Units
Thermodynamic properties
molar heat of vaporization | 38.1 kJ/mol specific heat of vaporization | 0.2759 kJ/g (at STP)
Chemical identifiers
OCC InChI identifier | InChI=1/C4H10O3P/c1-3-6-8(5)7-4-2/h3-4H2, 1-2H3/q+1 InChI key | MJUJXFBTEFXVKU-UHFFFAOYAQ RTECS number | TG7875000 MDL number | MFCD00044573](../image_source/541c5713438918014f8b1d01a03b52e9.png)
CAS number | 762-04-9 Beilstein number | 605759 PubChem CID number | 6327654 PubChem SID number | 24862594 SMILES identifier | CCO[P+](=O)OCC InChI identifier | InChI=1/C4H10O3P/c1-3-6-8(5)7-4-2/h3-4H2, 1-2H3/q+1 InChI key | MJUJXFBTEFXVKU-UHFFFAOYAQ RTECS number | TG7875000 MDL number | MFCD00044573
Safety properties
flash point | 82.22 °C
Toxicity properties
RTECS classes | other