Input interpretation
deuterated trimethylboron
Chemical names and formulas
formula | B(CD_3)_3 Hill formula | C_3D_9B name | deuterated trimethylboron IUPAC name | tris(trideuteriomethyl)borane alternate names | trimethylboron-d9 | tris(trideuteriomethyl)borane mass fractions | C (carbon) 0.555% | B (boron) 0.166% | H (hydrogen) 0.279%
Lewis structure
Draw the Lewis structure of deuterated trimethylboron. Start by drawing the overall structure of the molecule: Count the total valence electrons of the boron (n_B, val = 3), carbon (n_C, val = 4), and hydrogen (n_H, val = 1) atoms: n_B, val + 3 n_C, val + 9 n_H, val = 24 Calculate the number of electrons needed to completely fill the valence shells for boron (n_B, full = 6), carbon (n_C, full = 8), and hydrogen (n_H, full = 2): n_B, full + 3 n_C, full + 9 n_H, full = 48 Subtracting these two numbers shows that 48 - 24 = 24 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 12 bonds and hence 24 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 24 - 24 = 0 electrons left to draw and the diagram is complete: Answer: | |
Basic properties
molar mass | 64.97 g/mol phase | gas (at STP) melting point | -161.5 °C boiling point | -20.2 °C
Units
Gas properties (at STP)
vapor density | 2.3 (relative to air)
Non-standard atom properties
H-2 | 9
Chemical identifiers
CAS number | 6063-55-4 PubChem CID number | 16213066 PubChem SID number | 24870063 SMILES identifier | B(C)(C)C InChI identifier | InChI=1/C3H9B/c1-4(2)3/h1-3H3/i1D3, 2D3, 3D3 MDL number | MFCD00145460