Input interpretation
perfluoroeicosane
Chemical names and formulas
formula | CF_3(CF_2)_18CF_3 Hill formula | C_20F_42 name | perfluoroeicosane IUPAC name | 1, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13, 14, 14, 15, 15, 16, 16, 17, 17, 18, 18, 19, 19, 20, 20, 20-dotetracontafluoroicosane alternate names | 1, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13, 14, 14, 15, 15, 16, 16, 17, 17, 18, 18, 19, 19, 20, 20, 20-dotetracontafluoroicosane mass fractions | C (carbon) 23.1% | F (fluorine) 76.9%
Lewis structure
Draw the Lewis structure of perfluoroeicosane. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4) and fluorine (n_F, val = 7) atoms: 20 n_C, val + 42 n_F, val = 374 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8) and fluorine (n_F, full = 8): 20 n_C, full + 42 n_F, full = 496 Subtracting these two numbers shows that 496 - 374 = 122 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 61 bonds and hence 122 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 374 - 122 = 252 electrons left to draw: Answer: | |
Basic properties
molar mass | 1038.15 g/mol phase | solid (at STP) melting point | 165 °C
Units
Chemical identifiers
CAS number | 37589-57-4 PubChem CID number | 520855 PubChem SID number | 24856295 SMILES identifier | C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F InChI identifier | InChI=1/C20F42/c21-1(22, 3(25, 26)5(29, 30)7(33, 34)9(37, 38)11(41, 42)13(45, 46)15(49, 50)17(53, 54)19(57, 58)59)2(23, 24)4(27, 28)6(31, 32)8(35, 36)10(39, 40)12(43, 44)14(47, 48)16(51, 52)18(55, 56)20(60, 61)62 MDL number | MFCD00000438