Search

name of chromium(II) oxalate

Input interpretation

chromium(II) oxalate
chromium(II) oxalate

Chemical names and formulas

formula | CrC_2O_4 Hill formula | C_2CrO_4 name | chromium(II) oxalate IUPAC name | chromium(+2) cation; oxalate alternate names | chromium oxalate | chromium oxalate(1:1) | chromous oxalate | ethanedioic acid, chromium(2+) salt (1:1) | oxalic acid, chromium(2+) salt (1:1) mass fractions | C (carbon) 17.2% | Cr (chromium) 37.1% | O (oxygen) 45.7%
formula | CrC_2O_4 Hill formula | C_2CrO_4 name | chromium(II) oxalate IUPAC name | chromium(+2) cation; oxalate alternate names | chromium oxalate | chromium oxalate(1:1) | chromous oxalate | ethanedioic acid, chromium(2+) salt (1:1) | oxalic acid, chromium(2+) salt (1:1) mass fractions | C (carbon) 17.2% | Cr (chromium) 37.1% | O (oxygen) 45.7%

Structure diagram

Structure diagram
Structure diagram
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993

Basic properties

molar mass | 140.01 g/mol
molar mass | 140.01 g/mol

Units

Chemical identifiers

CAS number | 814-90-4 PubChem CID number | 13147 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Cr+2] InChI identifier | InChI=1/C2H2O4.Cr/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cr/q-2;m EU number | 212-410-9 Gmelin number | 140964
CAS number | 814-90-4 PubChem CID number | 13147 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Cr+2] InChI identifier | InChI=1/C2H2O4.Cr/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cr/q-2;m EU number | 212-410-9 Gmelin number | 140964

Ion equivalents

Cr^(2+) (chromium(II) cation) | 1 (C_2O_4)^(2-) (oxalate anion) | 1
Cr^(2+) (chromium(II) cation) | 1 (C_2O_4)^(2-) (oxalate anion) | 1