Input interpretation
copper(II) carbonate
Chemical names and formulas
formula | CuCO_3 Hill formula | CCuO_3 name | copper(II) carbonate IUPAC name | copper carbonate alternate names | carbonic acid, copper(1++) salt | carbonic acid, copper(2+) salt (1:1) | copper carbonate | cupric carbonate mass fractions | C (carbon) 9.72% | Cu (copper) 51.4% | O (oxygen) 38.8%
Structure diagram
Structure diagram
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
Basic properties
molar mass | 123.55 g/mol phase | solid (at STP) melting point | 200 °C
Units
Thermodynamic properties
specific free energy of formation Δ_fG° | solid | -4.192 kJ/g molar free energy of formation Δ_fG° | solid | -518 kJ/mol specific heat of formation Δ_fH° | solid | -4.816 kJ/g molar heat of formation Δ_fH° | solid | -595 kJ/mol specific entropy S° | solid | 0.7122 J/(g K) molar entropy S° | solid | 88 J/(mol K) (at STP)
Chemical identifiers
CAS number | 1184-64-1 PubChem CID number | 14452 SMILES identifier | C(=O)([O-])[O-].[Cu+2] InChI identifier | InChI=1/CH2O3.Cu/c2-1(3)4;/h(H2, 2, 3, 4);/q;+2/p-2/fCO3.Cu/q-2;m EU number | 214-671-4 Gmelin number | 8546 RTECS number | FF9500000
Toxicity properties
RTECS classes | human data
Ion equivalents
Cu^(2+) (copper(II) cation) | 1 (CO_3)^(2-) (carbonate anion) | 1