Search

cobalt(II) carbonate hydrate vs aluminum sulfate hydrate

Input interpretation

cobalt(II) carbonate hydrate | aluminum sulfate hydrate
cobalt(II) carbonate hydrate | aluminum sulfate hydrate

Chemical names and formulas

| cobalt(II) carbonate hydrate | aluminum sulfate hydrate formula | CoCO_3·xH_2O | Al_2(SO_4)_3·xH_2O Hill formula | CH_2CoO_4 | Al_2H_2O_13S_3 name | cobalt(II) carbonate hydrate | aluminum sulfate hydrate IUPAC name | cobaltous carbonate hydrate | dialuminum trisulfate hydrate alternate names | cobalt(+2) cation carbonate hydrate | cobaltous carbonate hydrate | dialuminum trisulfate hydrate mass fractions | C (carbon) 8.77% | Co (cobalt) 43% | H (hydrogen) 1.47% | O (oxygen) 46.7% | Al (aluminum) 15% | H (hydrogen) 0.56% | O (oxygen) 57.8% | S (sulfur) 26.7%
| cobalt(II) carbonate hydrate | aluminum sulfate hydrate formula | CoCO_3·xH_2O | Al_2(SO_4)_3·xH_2O Hill formula | CH_2CoO_4 | Al_2H_2O_13S_3 name | cobalt(II) carbonate hydrate | aluminum sulfate hydrate IUPAC name | cobaltous carbonate hydrate | dialuminum trisulfate hydrate alternate names | cobalt(+2) cation carbonate hydrate | cobaltous carbonate hydrate | dialuminum trisulfate hydrate mass fractions | C (carbon) 8.77% | Co (cobalt) 43% | H (hydrogen) 1.47% | O (oxygen) 46.7% | Al (aluminum) 15% | H (hydrogen) 0.56% | O (oxygen) 57.8% | S (sulfur) 26.7%

Structure diagrams

Structure diagrams
Structure diagrams

Basic properties

| cobalt(II) carbonate hydrate | aluminum sulfate hydrate molar mass | 136.96 g/mol | 360.1 g/mol density | 4.13 g/cm^3 | 1.69 g/cm^3 solubility in water | | soluble
| cobalt(II) carbonate hydrate | aluminum sulfate hydrate molar mass | 136.96 g/mol | 360.1 g/mol density | 4.13 g/cm^3 | 1.69 g/cm^3 solubility in water | | soluble

Units

Chemical identifiers

| cobalt(II) carbonate hydrate | aluminum sulfate hydrate CAS number | 57454-67-8 | 17927-65-0 PubChem CID number | 16211458 | 3080712 PubChem SID number | 24852047 | 24862907 SMILES identifier | C(=O)([O-])[O-].O.[Co+2] | O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Al+3].[Al+3] InChI identifier | InChI=1/CH2O3.Co.H2O/c2-1(3)4;;/h(H2, 2, 3, 4);;1H2/q;+2;/p-2/fCO3.Co.H2O/q-2;m; | InChI=1/2Al.3H2O4S.H2O/c;;3*1-5(2, 3)4;/h;;3*(H2, 1, 2, 3, 4);1H2/q2*+3;;;;/p-6/f2Al.3O4S.H2O/q2m;3*-2; Gmelin number | | 61799 MDL number | MFCD00149654 | MFCD00149138
| cobalt(II) carbonate hydrate | aluminum sulfate hydrate CAS number | 57454-67-8 | 17927-65-0 PubChem CID number | 16211458 | 3080712 PubChem SID number | 24852047 | 24862907 SMILES identifier | C(=O)([O-])[O-].O.[Co+2] | O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Al+3].[Al+3] InChI identifier | InChI=1/CH2O3.Co.H2O/c2-1(3)4;;/h(H2, 2, 3, 4);;1H2/q;+2;/p-2/fCO3.Co.H2O/q-2;m; | InChI=1/2Al.3H2O4S.H2O/c;;3*1-5(2, 3)4;/h;;3*(H2, 1, 2, 3, 4);1H2/q2*+3;;;;/p-6/f2Al.3O4S.H2O/q2m;3*-2; Gmelin number | | 61799 MDL number | MFCD00149654 | MFCD00149138

NFPA label

NFPA label
NFPA label
| aluminum sulfate hydrate NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
| aluminum sulfate hydrate NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0

Random Queries

MDL number of acetic acid
group of silicon
IUPAC name of ammonium persulfate
IUCr space group number of period 3 elements
freezing point of ethylene glycol
PubChem CID number of fluoromethane
molar mass of ethyl acetate
mass magnetic susceptibilities of insulators
melting point of red phosphorus vs copper
chemical types of strontium hydrogenphosphate vs vanadyl 2,3-naphthalocyanine