Input interpretation
D-(-)-fructose
Chemical names and formulas
formula | C_6H_12O_6 name | D-(-)-fructose IUPAC name | (2R, 3S, 4R, 5R)-2-(hydroxymethyl)oxane-2, 3, 4, 5-tetrol alternate names | arabino-hexulose | D-fructose | fructose | fruit sugar mass fractions | C (carbon) 40% | H (hydrogen) 6.71% | O (oxygen) 53.3%
Lewis structure
Draw the Lewis structure of D-(-)-fructose. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 12 n_H, val + 6 n_O, val = 72 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 12 n_H, full + 6 n_O, full = 120 Subtracting these two numbers shows that 120 - 72 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 72 - 48 = 24 electrons left to draw: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 180.16 g/mol phase | solid (at STP) melting point | 105 °C boiling point | 552 °C density | 1.459 g/cm^3
Units
Hydrophobicity and permeability properties
predicted LogP hydrophobicity | -2.44 predicted LogS | 0.79
Basic drug properties
approval status | experimental | small molecule
Solid properties (at STP)
density | 1.459 g/cm^3 vapor pressure | 2×10^-14 mmHg (at 25 °C) refractive index | 1.5101
Units
Thermodynamic properties
molar heat of vaporization | 95.7 kJ/mol specific heat of vaporization | 0.531 kJ/g molar heat of combustion | 2813 kJ/mol specific heat of combustion | 15.61 kJ/g (at STP)
Chemical identifiers
CAS number | 57-48-7 Beilstein number | 1239004 PubChem CID number | 24310 PubChem SID number | 7887582 SMILES identifier | C1C(C(C(C(O1)(CO)O)O)O)O InChI identifier | InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1 InChI key | RFSUNEUAIZKAJO-UHFFFAOYAG EU number | 200-333-3 RTECS number | LS7120000
NFPA label
NFPA label
NFPA health rating | 0 NFPA fire rating | 0 NFPA reactivity rating | 0
Safety properties
flash point | 301 °C
Toxicity properties
RTECS classes | other