Search

D-(-)-fructose

Input interpretation

D-(-)-fructose
D-(-)-fructose

Chemical names and formulas

formula | C_6H_12O_6 name | D-(-)-fructose IUPAC name | (2R, 3S, 4R, 5R)-2-(hydroxymethyl)oxane-2, 3, 4, 5-tetrol alternate names | arabino-hexulose | D-fructose | fructose | fruit sugar mass fractions | C (carbon) 40% | H (hydrogen) 6.71% | O (oxygen) 53.3%
formula | C_6H_12O_6 name | D-(-)-fructose IUPAC name | (2R, 3S, 4R, 5R)-2-(hydroxymethyl)oxane-2, 3, 4, 5-tetrol alternate names | arabino-hexulose | D-fructose | fructose | fruit sugar mass fractions | C (carbon) 40% | H (hydrogen) 6.71% | O (oxygen) 53.3%

Lewis structure

Draw the Lewis structure of D-(-)-fructose. Start by drawing the overall structure of the molecule:  Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 12 n_H, val + 6 n_O, val = 72 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 12 n_H, full + 6 n_O, full = 120 Subtracting these two numbers shows that 120 - 72 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 72 - 48 = 24 electrons left to draw: Answer: |   |
Draw the Lewis structure of D-(-)-fructose. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 12 n_H, val + 6 n_O, val = 72 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 12 n_H, full + 6 n_O, full = 120 Subtracting these two numbers shows that 120 - 72 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 72 - 48 = 24 electrons left to draw: Answer: | |

3D structure

3D structure
3D structure

Basic properties

molar mass | 180.16 g/mol phase | solid (at STP) melting point | 105 °C boiling point | 552 °C density | 1.459 g/cm^3
molar mass | 180.16 g/mol phase | solid (at STP) melting point | 105 °C boiling point | 552 °C density | 1.459 g/cm^3

Units

Hydrophobicity and permeability properties

predicted LogP hydrophobicity | -2.44 predicted LogS | 0.79
predicted LogP hydrophobicity | -2.44 predicted LogS | 0.79

Basic drug properties

approval status | experimental | small molecule
approval status | experimental | small molecule

Solid properties (at STP)

density | 1.459 g/cm^3 vapor pressure | 2×10^-14 mmHg (at 25 °C) refractive index | 1.5101
density | 1.459 g/cm^3 vapor pressure | 2×10^-14 mmHg (at 25 °C) refractive index | 1.5101

Units

Thermodynamic properties

molar heat of vaporization | 95.7 kJ/mol specific heat of vaporization | 0.531 kJ/g molar heat of combustion | 2813 kJ/mol specific heat of combustion | 15.61 kJ/g (at STP)
molar heat of vaporization | 95.7 kJ/mol specific heat of vaporization | 0.531 kJ/g molar heat of combustion | 2813 kJ/mol specific heat of combustion | 15.61 kJ/g (at STP)

Chemical identifiers

CAS number | 57-48-7 Beilstein number | 1239004 PubChem CID number | 24310 PubChem SID number | 7887582 SMILES identifier | C1C(C(C(C(O1)(CO)O)O)O)O InChI identifier | InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1 InChI key | RFSUNEUAIZKAJO-UHFFFAOYAG EU number | 200-333-3 RTECS number | LS7120000
CAS number | 57-48-7 Beilstein number | 1239004 PubChem CID number | 24310 PubChem SID number | 7887582 SMILES identifier | C1C(C(C(C(O1)(CO)O)O)O)O InChI identifier | InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1 InChI key | RFSUNEUAIZKAJO-UHFFFAOYAG EU number | 200-333-3 RTECS number | LS7120000

NFPA label

NFPA label
NFPA label
NFPA health rating | 0 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 0 NFPA fire rating | 0 NFPA reactivity rating | 0

Safety properties

flash point | 301 °C
flash point | 301 °C

Toxicity properties

RTECS classes | other
RTECS classes | other