Input interpretation
D-glucose-C-d 797-99 atom%D
Chemical names and formulas
formula | C_6H_5D_7O_6 name | D-glucose-C-d 797-99 atom%D IUPAC name | (2S, 3R, 4S, 5S, 6R)-2, 3, 4, 5, 6-pentadeuterio-6-(dideuterio-hydroxymethyl)tetrahydropyran-2, 3, 4, 5-tetrol alternate names | (2S, 3R, 4S, 5S, 6R)-2, 3, 4, 5, 6-pentadeuterio-6-(dideuterio-hydroxy-methyl)oxane-2, 3, 4, 5-tetrol | (2S, 3R, 4S, 5S, 6R)-2, 3, 4, 5, 6-pentadeuterio-6-(dideuterio-hydroxymethyl)oxane-2, 3, 4, 5-tetrol | (2S, 3R, 4S, 5S, 6R)-2, 3, 4, 5, 6-pentadeuterio-6-(dideuterio-hydroxy-methyl)tetrahydropyran-2, 3, 4, 5-tetrol | dextrose-C-d7 | D-glucose-1, 2, 3, 4, 5, 6, 6-d7 mass fractions | O (oxygen) 0.513% | C (carbon) 0.385% | H (hydrogen) 0.102%
Lewis structure
Draw the Lewis structure of D-glucose-C-d 797-99 atom%D. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 12 n_H, val + 6 n_O, val = 72 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 12 n_H, full + 6 n_O, full = 120 Subtracting these two numbers shows that 120 - 72 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 72 - 48 = 24 electrons left to draw: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 187.2 g/mol phase | solid (at STP) melting point | 151 °C
Units
Non-standard atom properties
H-2 | 7
Chemical identifiers
CAS number | 23403-54-5 PubChem CID number | 16217112 PubChem SID number | 24879246 SMILES identifier | C(C1C(C(C(C(O1)O)O)O)O)O InChI identifier | InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H, 1H2/t2-, 3-, 4+, 5-, 6+/m1/s1/i1D2, 2D, 3D, 4D, 5D, 6D MDL number | MFCD00144081