Search

InChI identifier of thallium sulfide vs thallium(III) nitrate trihydrate

Input interpretation

thallium sulfide thallium(III) nitrate trihydrate | InChI identifier
thallium sulfide thallium(III) nitrate trihydrate | InChI identifier

Results

thallium sulfide | InChI=1/S.2Tl/rSTl2/c2-1-3 thallium(III) nitrate trihydrate | InChI=1/HNO3.H2O.Tl/c2-1(3)4;;/h(H, 2, 3, 4);1H2;/f/h2H;;
thallium sulfide | InChI=1/S.2Tl/rSTl2/c2-1-3 thallium(III) nitrate trihydrate | InChI=1/HNO3.H2O.Tl/c2-1(3)4;;/h(H, 2, 3, 4);1H2;/f/h2H;;

Random Queries

molar volume of group 13 elements
molar mass of acetylene vs 2-methylheptadecane
formula of pentaamminechloroiridium(III) chloride
IUPAC name of propylene vs titanium trichloride
density of zinc oxide vs niobium(IV) iodide
image of sodium
zinc vs lead vs indium
name of calcium telluride
absorption of fluoxetine
density of bromine vs chlorine