Search

name of tetrabutylammonium

Input interpretation

tetrabutylammonium nitrate
tetrabutylammonium nitrate

Chemical names and formulas

formula | (CH_3CH_2CH_2CH_2)_4N(NO_3) Hill formula | C_16H_36N_2O_3 name | tetrabutylammonium nitrate alternate names | N-N-N-tributyl-1-butanaminium nitrate | tetrabutylammonium | tetrabutylazanium nitrate | tetra-N-butylammonium nitrate mass fractions | C (carbon) 63.1% | H (hydrogen) 11.9% | N (nitrogen) 9.2% | O (oxygen) 15.8%
formula | (CH_3CH_2CH_2CH_2)_4N(NO_3) Hill formula | C_16H_36N_2O_3 name | tetrabutylammonium nitrate alternate names | N-N-N-tributyl-1-butanaminium nitrate | tetrabutylammonium | tetrabutylazanium nitrate | tetra-N-butylammonium nitrate mass fractions | C (carbon) 63.1% | H (hydrogen) 11.9% | N (nitrogen) 9.2% | O (oxygen) 15.8%

Structure diagram

Structure diagram
Structure diagram
| bond counts | bond lengths | bond energies | 12 bonds | 1.5 Å | 346 kJ/mol | 36 bonds | 1.1 Å | 411 kJ/mol | 4 bonds | 1.5 Å | 305 kJ/mol | 1 bond | 1.2 Å | 607 kJ/mol | 2 bonds | 1.2 Å | 201 kJ/mol
| bond counts | bond lengths | bond energies | 12 bonds | 1.5 Å | 346 kJ/mol | 36 bonds | 1.1 Å | 411 kJ/mol | 4 bonds | 1.5 Å | 305 kJ/mol | 1 bond | 1.2 Å | 607 kJ/mol | 2 bonds | 1.2 Å | 201 kJ/mol

3D structure

3D structure
3D structure

Basic properties

molar mass | 304.47 g/mol phase | solid (at STP) melting point | 117 °C
molar mass | 304.47 g/mol phase | solid (at STP) melting point | 117 °C

Units

Chemical identifiers

CAS number | 1941-27-1 Beilstein number | 3921016 PubChem CID number | 16027 PubChem SID number | 24862056 SMILES identifier | CCCC[N+](CCCC)(CCCC)CCCC.[N+](=O)([O-])[O-] InChI identifier | InChI=1/C16H36N.NO3/c1-5-9-13-17(14-10-6-2, 15-11-7-3)16-12-8-4;2-1(3)4/h5-16H2, 1-4H3;/q+1;-1 RTECS number | BS5475000 MDL number | MFCD00043202
CAS number | 1941-27-1 Beilstein number | 3921016 PubChem CID number | 16027 PubChem SID number | 24862056 SMILES identifier | CCCC[N+](CCCC)(CCCC)CCCC.[N+](=O)([O-])[O-] InChI identifier | InChI=1/C16H36N.NO3/c1-5-9-13-17(14-10-6-2, 15-11-7-3)16-12-8-4;2-1(3)4/h5-16H2, 1-4H3;/q+1;-1 RTECS number | BS5475000 MDL number | MFCD00043202

NFPA label

NFPA label
NFPA label
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0

Toxicity properties

RTECS classes | other
RTECS classes | other

Random Queries

freezing point of sodium phosphotungstate hydrate
formula of tungsten(VI) cation vs iron(III) cation
CAS number of tridymite
formula of ethyl ether vs n-amyl acetate
formula of cobalt(II) basic carbonate vs [5,6]-fullerene-C70
freezing point of silver telluride vs europium(III) oxide
atomic spectrum of dysprosium
density of aluminum vs argon
name of ammonium sulfite monohydrate
molar mass of rubidium fluoride vs zinc fluoride