Input interpretation
sodium carbonate decahydrate
Chemical names and formulas
formula | Na_2CO_3·10H_2O Hill formula | CH_20Na_2O_13 name | sodium carbonate decahydrate IUPAC name | disodium carbonate decahydrate alternate names | carbonic acid disodium salt, decahydrate | disodium carbonate decahydrate | natrii carbonas decahydricus | soda | sodium carbonate mass fractions | C (carbon) 4.2% | H (hydrogen) 7.05% | Na (sodium) 16.1% | O (oxygen) 72.7%
Structure diagram
Structure diagram
Basic properties
molar mass | 286.14 g/mol phase | solid (at STP) melting point | 33 °C density | 1.46 g/cm^3 solubility in water | soluble
Units
Solid properties (at STP)
density | 1.46 g/cm^3
Units
Thermodynamic properties
molar heat of fusion | 67.1 kJ/mol specific heat of fusion | 0.2345 kJ/g (at STP)
Chemical identifiers
![CAS number | 6132-02-1 PubChem CID number | 151402 PubChem SID number | 24880894 SMILES identifier | C(=O)([O-])[O-].O.O.O.O.O.O.O.O.O.O.[Na+].[Na+] InChI identifier | InChI=1/CH2O3.2Na.10H2O/c2-1(3)4;;;;;;;;;;;;/h(H2, 2, 3, 4);;;10*1H2/q;2*+1;;;;;;;;;;/p-2/fCO3.2Na.10H2O/q-2;2m;;;;;;;;;; MDL number | MFCD00149178](../image_source/0a20881932798e056d3a30ae6df5ca38.png)
CAS number | 6132-02-1 PubChem CID number | 151402 PubChem SID number | 24880894 SMILES identifier | C(=O)([O-])[O-].O.O.O.O.O.O.O.O.O.O.[Na+].[Na+] InChI identifier | InChI=1/CH2O3.2Na.10H2O/c2-1(3)4;;;;;;;;;;;;/h(H2, 2, 3, 4);;;10*1H2/q;2*+1;;;;;;;;;;/p-2/fCO3.2Na.10H2O/q-2;2m;;;;;;;;;; MDL number | MFCD00149178
Ion equivalents
Na^+ (sodium cation) | 2 (CO_3)^(2-) (carbonate anion) | 1