Search

InChI identifier of sodium bromate

Input interpretation

sodium bromate | InChI identifier
sodium bromate | InChI identifier

Result

InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m
InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m

Random Queries

bismuth vs aluminum vs gallium
InChI identifier of 4-sulfophenyl isothiocyanate sodium salt monohydrate
CAS number of chromium(III) telluride vs manganese(II) pyrovanadate
short electronic configuration of hydrogen vs sulfur
boron anion vs dibutyl phosphate
non-standard isotope numbers of cesium dichloroiodide
neutron mass absorption of platinum metals
name of nitrite anion
uvite
alternate names of copper(III) cation vs gold(V) cation