Search

InChI identifier of sodium bromate

Input interpretation

sodium bromate | InChI identifier
sodium bromate | InChI identifier

Result

InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m
InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m

Random Queries

discovery year of lanthanum vs thulium
van der Waals radius tin
density of scandium vs boron trifluoride dihydrate
alternate names of dimethyl sulfoxide
Ca(NO3)2 = O2 + NO2 + CaO
probable lethal dose for man of toluene
collar option
alternate names of titanium(IV) iodide
mass magnetic susceptibility of scandium
formula of sulfide anion vs sulfite anion