Search

name of uranyl nitrate

Input interpretation

uranyl nitrate
uranyl nitrate

Chemical names and formulas

formula | U_2(NO_3)_2 Hill formula | N_2O_6U_2 name | uranyl nitrate mass fractions | N (nitrogen) 7.11% | O (oxygen) 32.5% | U (uranium) 60.4%
formula | U_2(NO_3)_2 Hill formula | N_2O_6U_2 name | uranyl nitrate mass fractions | N (nitrogen) 7.11% | O (oxygen) 32.5% | U (uranium) 60.4%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 394.03 g/mol
molar mass | 394.03 g/mol

Units

Chemical identifiers

CAS number | 10102-06-4 SMILES identifier | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O=[U+2]=O
CAS number | 10102-06-4 SMILES identifier | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O=[U+2]=O

Random Queries

apply filling transform image ferberite
FeS + Na2O2 = Na2SO4 + Fe2O3 + Na2O
structure diagram of calcium cation
iron(II) arsenate vs tetraethylammonium trifluoroacetate
molar mass of ethylamine vs ammonia
H2SO4 + KClO4 + Ti2(SO4)3 = H2O + Cl2 + K2SO4 + Ti(SO4)2
freezing point of sodium hydride vs lithium
PubChem CID number of diphosphorus
IUPAC name of iron(II) oxide vs rhodium(III) oxide hydrate
CAS number of 1,4-bis(trifluoromethyl)benzene-13 C6 vs vinyl fluoride