Search

SMILES identifier of scopolamine vs propionaldehyde

Input interpretation

scopolamine propionaldehyde | SMILES identifier
scopolamine propionaldehyde | SMILES identifier

Results

scopolamine | CN1C2CC(CC1C3C2O3)OC(=O)C(CO)C4=CC=CC=C4 propionaldehyde | CCC=O
scopolamine | CN1C2CC(CC1C3C2O3)OC(=O)C(CO)C4=CC=CC=C4 propionaldehyde | CCC=O

Random Queries

CAS number of sodium pyruvate-3-13 C
SMILES identifier of hydrocodone-N-methyl-d 3solution
chemical types of deuterium bromide vs 2-bromophenol
IUCr space group number of rhodium
cleavage of queitite vs hillebrandite
freezing point of calcium oxalate monohydrate vs androsterone
what is the third hardest element of the periodic table
hypoiodite anion vs hydrogen phosphate anion vs chromate anion
chemical types of DL-arginine hydrochloride monohydrate
CAS number of tropolone vs 1-(2-hydroxyphenyl)-3-phenyl-1,3-propanedione