Input interpretation
sodium carbonate monohydrate
Chemical names and formulas
formula | Na_2CO_3·H_2O Hill formula | CH_2Na_2O_4 name | sodium carbonate monohydrate IUPAC name | disodium carbonate hydrate alternate names | disodium carbonate monohydrate | getrocknetes natriumkcarbonat | sodium carbonate mass fractions | C (carbon) 9.69% | H (hydrogen) 1.63% | Na (sodium) 37.1% | O (oxygen) 51.6%
Structure diagram
Structure diagram
Basic properties
molar mass | 124 g/mol phase | solid (at STP) melting point | 107.85 °C density | 2.25 g/cm^3
Units
Solid properties (at STP)
density | 2.25 g/cm^3
Units
Thermodynamic properties
molar heat of fusion | 14.8 kJ/mol specific heat of fusion | 0.1194 kJ/g (at STP)
Chemical identifiers
![CAS number | 5968-11-6 PubChem CID number | 62596 SMILES identifier | C(=O)([O-])[O-].O.[Na+].[Na+] InChI identifier | InChI=1/CH2O3.2Na.H2O/c2-1(3)4;;;/h(H2, 2, 3, 4);;;1H2/q;2*+1;/p-2/fCO3.2Na.H2O/q-2;2m; Gmelin number | 1263273](../image_source/0074d4fe02ad70c3153d46d9ce74462b.png)
CAS number | 5968-11-6 PubChem CID number | 62596 SMILES identifier | C(=O)([O-])[O-].O.[Na+].[Na+] InChI identifier | InChI=1/CH2O3.2Na.H2O/c2-1(3)4;;;/h(H2, 2, 3, 4);;;1H2/q;2*+1;/p-2/fCO3.2Na.H2O/q-2;2m; Gmelin number | 1263273
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
Toxicity properties
odor | odorless