Input interpretation
sodium propionate
Chemical names and formulas
formula | CH_3CH_2COONa Hill formula | C_3H_5NaO_2 name | sodium propionate IUPAC name | sodium propanoate alternate names | impedex | propionic acid, sodium salt | propionic acid sodium salt | sodium propanoate | sodium propionoate mass fractions | C (carbon) 37.5% | H (hydrogen) 5.25% | Na (sodium) 23.9% | O (oxygen) 33.3%
Structure diagram
Structure diagram
vertex count | 6 edge count | 4 Schultz index | 68 Wiener index | 18 Hosoya index | 7 Balaban index | 2.54
Basic properties
molar mass | 96.06 g/mol phase | solid (at STP) melting point | 285.5 °C
Units
Thermodynamic properties
molar heat of fusion | 13.3 kJ/mol specific heat of fusion | 0.1385 kJ/g (at STP)
Chemical identifiers
![CAS number | 137-40-6 Beilstein number | 3566934 PubChem CID number | 2723816 SMILES identifier | CCC(=O)[O-].[Na+] InChI identifier | InChI=1/C3H6O2.Na/c1-2-3(4)5;/h2H2, 1H3, (H, 4, 5);/q;+1/p-1/fC3H5O2.Na/q-1;m RTECS number | UF7525000 MDL number | MFCD00002759](../image_source/942663dd60bd6cd26a9d27c6698b59eb.png)
CAS number | 137-40-6 Beilstein number | 3566934 PubChem CID number | 2723816 SMILES identifier | CCC(=O)[O-].[Na+] InChI identifier | InChI=1/C3H6O2.Na/c1-2-3(4)5;/h2H2, 1H3, (H, 4, 5);/q;+1/p-1/fC3H5O2.Na/q-1;m RTECS number | UF7525000 MDL number | MFCD00002759
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
Toxicity properties
RTECS classes | agricultural chemical and pesticide