Search

InChI identifier β-D-fructopyranose

Input interpretation

β-D-fructopyranose | InChI identifier
β-D-fructopyranose | InChI identifier

Result

InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1
InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1

Random Queries

density of calcium peroxide
chemical types of potassium chloride vs sodium hydride
formula of cobalt(II,III) oxide
freezing point of calcium hydroxide vs pearl ash
Al-31 vs Te-139
alternate names of chloroacetic acid vs selenious acid
structure diagram of hassium
H2SO4 + KClO3 + K2S = H2O + K2SO4 + S + KCl
chemical types of 3-methylbenzylmagnesium chloride
melting point of hydroxylamine perchlorate