Search

InChI identifier β-D-fructopyranose

Input interpretation

β-D-fructopyranose | InChI identifier
β-D-fructopyranose | InChI identifier

Result

InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1
InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1

Random Queries

alternate names of iron
molar mass of aluminum cation vs silver(I) cation
density of cesium fluoroborate
boiling point of oxygen vs beryllium
structure diagram of niobium(V) cation
alternate names of ammonium bisulfate
H2SO4 + KMnO4 + FeSO = H2O + K2SO4 + MnSO4 + Fe2(SO4)3
color of carbon vs selenium
chemical types of gallium(III) fluoride trihydrate
chemical types neodymium antimonide