Search

InChI identifier of D-(-)-fructose

Input interpretation

D-(-)-fructose | InChI identifier
D-(-)-fructose | InChI identifier

Result

InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1
InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1

Random Queries

critical pressure of halogenated compounds
Mg + ZnSO4 = Zn + MgSO4
CAS number of xenon pentafluoride hexafluoroarsenate
density of efremovite vs tschermigite
ion class of lutetium(III) cation vs scandium(I) cation
Mg + FeCl2 = Fe + MgCl2
melting point of boron nitride
discovery year of chromium vs scandium
solarization effect image buttgenbachite
alternate names of 10-bromoanthracene-9-boronic acid