Search

InChI identifier of D-(-)-fructose

Input interpretation

D-(-)-fructose | InChI identifier
D-(-)-fructose | InChI identifier

Result

InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1
InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1

Random Queries

arsenic isotopes
KMnO4 = O2 + MnO2 + K2MnO3
H2SO4 + K2MnO4 + K2S = H2O + K2SO4 + S + MnSO4
color of gallium vs nickel
chemical types of fast sky blue vs 5-nitrobenzimidazole nitrate
chemical types of platinum silicide vs cerium(IV) hydroxide
CAS number of chlorodifluoroacetic acid
MDL number of potassium vs mercury(II) fluoride
atomic number of tantalum vs ytterbium
silver chloride vs uranyl chloride