Input interpretation
stearoyl chloride
Chemical names and formulas
formula | CH_3(CH_2)_16COCl Hill formula | C_18H_35ClO name | stearoyl chloride IUPAC name | octadecanoyl chloride alternate names | N-octadecanoyl chloride | octadecanoyl chloride | stearic acid chloride | stearyl chloride mass fractions | C (carbon) 71.4% | Cl (chlorine) 11.7% | H (hydrogen) 11.6% | O (oxygen) 5.28%
Lewis structure
Draw the Lewis structure of stearoyl chloride. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 18 n_C, val + n_Cl, val + 35 n_H, val + n_O, val = 120 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 18 n_C, full + n_Cl, full + 35 n_H, full + n_O, full = 230 Subtracting these two numbers shows that 230 - 120 = 110 bonding electrons are needed. Each bond has two electrons, so in addition to the 54 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
Basic properties
molar mass | 302.93 g/mol phase | liquid (at STP) melting point | 21.5 °C boiling point | 176 °C (measured at 266.6 Pa) density | 0.897 g/cm^3 solubility in water | insoluble
Units
Liquid properties (at STP)
density | 0.897 g/cm^3 vapor pressure | 5×10^-5 mmHg (at 25 °C) refractive index | 1.454
Units
Thermodynamic properties
molar heat of vaporization | 59.2 kJ/mol specific heat of vaporization | 0.1954 kJ/g (at STP)
Chemical identifiers
CAS number | 112-76-5 Beilstein number | 639784 PubChem CID number | 8212 PubChem SID number | 24850056 SMILES identifier | CCCCCCCCCCCCCCCCCC(=O)Cl InChI identifier | InChI=1/C18H35ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2, 1H3 RTECS number | RG2162000 MDL number | MFCD00000744
Safety properties
flash point | 110 °C
DOT hazard class | 8 DOT numbers | 3265
Toxicity properties
RTECS classes | other