Search

SMILES identifier of chloroplatinic acid hydrate vs 3,4-(methylenedioxy)phenylboronic acid

Input interpretation

chloroplatinic acid hydrate 3, 4-(methylenedioxy)phenylboronic acid | SMILES identifier
chloroplatinic acid hydrate 3, 4-(methylenedioxy)phenylboronic acid | SMILES identifier

Results

chloroplatinic acid hydrate | O.Cl.Cl.Cl[Pt](Cl)(Cl)Cl 3, 4-(methylenedioxy)phenylboronic acid | B(C1=CC2=C(C=C1)OCO2)(O)O
chloroplatinic acid hydrate | O.Cl.Cl.Cl[Pt](Cl)(Cl)Cl 3, 4-(methylenedioxy)phenylboronic acid | B(C1=CC2=C(C=C1)OCO2)(O)O

Random Queries

HCl + HNO3 + HgS = H2O + S + NO + HgCl
sodium periodate trihydrate vs activated charcoal
freezing point of mellitic acid
molar mass of 2,6-dibromo-4-fluorophenol vs 4-amino-2-nitrophenol
MDL number of sodium fluoride
H2SO4 + CaBr2 = H2O + SO2 + Br2 + CaSO4
molar mass of ammonium sulfamate
freezing point of chlorine azide vs diphosphorous tetraiodide
chemical types of enfuvirtide
Hill formula of triphenylphosphine hydrobromide