Input interpretation
![phenolphthalein](../image_source/8fb399628dcb17d91367e2775b37f409.png)
phenolphthalein
Chemical names and formulas
![formula | C_20H_14O_4 name | phenolphthalein IUPAC name | 3, 3-bis(4-hydroxyphenyl)isobenzofuran-1-one alternate names | chocolax | espotabs | euchessina mass fractions | C (carbon) 75.5% | H (hydrogen) 4.43% | O (oxygen) 20.1%](../image_source/0675ad628af828008312c6884c846491.png)
formula | C_20H_14O_4 name | phenolphthalein IUPAC name | 3, 3-bis(4-hydroxyphenyl)isobenzofuran-1-one alternate names | chocolax | espotabs | euchessina mass fractions | C (carbon) 75.5% | H (hydrogen) 4.43% | O (oxygen) 20.1%
Lewis structure
![Draw the Lewis structure of phenolphthalein. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 20 n_C, val + 14 n_H, val + 4 n_O, val = 118 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 20 n_C, full + 14 n_H, full + 4 n_O, full = 220 Subtracting these two numbers shows that 220 - 118 = 102 bonding electrons are needed. Each bond has two electrons, so in addition to the 41 bonds already present in the diagram add 10 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 10 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |](../image_source/2085be2fb6ffebdfeb7e4933bbecd3f5.png)
Draw the Lewis structure of phenolphthalein. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 20 n_C, val + 14 n_H, val + 4 n_O, val = 118 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 20 n_C, full + 14 n_H, full + 4 n_O, full = 220 Subtracting these two numbers shows that 220 - 118 = 102 bonding electrons are needed. Each bond has two electrons, so in addition to the 41 bonds already present in the diagram add 10 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 10 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
![3D structure](../image_source/b8a42d156bccb889e23274ed5af749dc.png)
3D structure
Basic properties
![molar mass | 318.33 g/mol phase | solid (at STP) melting point | 260 °C density | 1.3 g/cm^3](../image_source/dfbe8bc242d1dd4f6d17d8fdfa0dfaa1.png)
molar mass | 318.33 g/mol phase | solid (at STP) melting point | 260 °C density | 1.3 g/cm^3
Units
pH sensitivity
![pH range | color change 8.2 to 10 | colorless to pink](../image_source/97fb352cfdef7bb94accbfc72fbcad28.png)
pH range | color change 8.2 to 10 | colorless to pink
Hydrophobicity and permeability properties
![experimental LogP hydrophobicity | 2.41 predicted LogP hydrophobicity | 4.42 predicted LogS | -4.51](../image_source/95b48deb37b967cbd932a08c967f0302.png)
experimental LogP hydrophobicity | 2.41 predicted LogP hydrophobicity | 4.42 predicted LogS | -4.51
Basic drug properties
![approval status | small molecule | withdrawn drug categories | indicators and reagent](../image_source/9d04164f7d9221661eadeb044587d6c9.png)
approval status | small molecule | withdrawn drug categories | indicators and reagent
![brand names | agoral | alophen | chocolax | colax | correctol | doxan | doxidan | espotabs | euchessina | evac-q-kit | evac-q-kwik | evac-q-tabs | evac-u-gen | evac-v-lax | Ex-lax | feen-a-mint gum | feen-a-mint laxative mints | femilax | koprol | LILO | lax-pills | laxcaps | laxin | laxogen | medilax | modane | modane plus | phenolax | phillips gelcaps | phthalimetten | phthalin | prulet | purga | purgen | purgophen | spulmako-lax | trilax](../image_source/bebee2617085999982528a0529dd72e1.png)
brand names | agoral | alophen | chocolax | colax | correctol | doxan | doxidan | espotabs | euchessina | evac-q-kit | evac-q-kwik | evac-q-tabs | evac-u-gen | evac-v-lax | Ex-lax | feen-a-mint gum | feen-a-mint laxative mints | femilax | koprol | LILO | lax-pills | laxcaps | laxin | laxogen | medilax | modane | modane plus | phenolax | phillips gelcaps | phthalimetten | phthalin | prulet | purga | purgen | purgophen | spulmako-lax | trilax
Solid properties (at STP)
![density | 1.3 g/cm^3 refractive index | 1.57](../image_source/3800b9953e9c309661ae2ba246a57078.png)
density | 1.3 g/cm^3 refractive index | 1.57
Units
Chemical identifiers
![CAS number | 77-09-8 Beilstein number | 284423 PubChem CID number | 4764 PubChem SID number | 10469431 SMILES identifier | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O InChI identifier | InChI=1/C20H14O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20/h1-12, 21-22H InChI key | KJFMBFZCATUALV-UHFFFAOYAH EU number | 201-004-7 RTECS number | SM8380000 NSC number | 215214](../image_source/cff45cda3e41aa387a14def20f87ce14.png)
CAS number | 77-09-8 Beilstein number | 284423 PubChem CID number | 4764 PubChem SID number | 10469431 SMILES identifier | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O InChI identifier | InChI=1/C20H14O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20/h1-12, 21-22H InChI key | KJFMBFZCATUALV-UHFFFAOYAH EU number | 201-004-7 RTECS number | SM8380000 NSC number | 215214
NFPA label
![NFPA label](../image_source/7ddf8a1ec9940f257016fa138be2d34c.png)
NFPA label
![NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0](../image_source/9437c45f8d7a52a4b0e9e5519d1586dc.png)
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
Toxicity properties
![odor | odorless](../image_source/14b96a79659981d2ab4e1499180f98b5.png)
odor | odorless
![RTECS classes | agricultural chemical and pesticide | tumorigen | mutagen | human data](../image_source/25c851f26895dced689d8250ed2cb767.png)
RTECS classes | agricultural chemical and pesticide | tumorigen | mutagen | human data