Search

InChI identifier of barium N-acetylneuraminate vs potassium hydrogen tartrate

Input interpretation

barium N-acetylneuraminate potassium hydrogen tartrate | InChI identifier
barium N-acetylneuraminate potassium hydrogen tartrate | InChI identifier

Results

barium N-acetylneuraminate | InChI=1/2C11H18NO9.Ba/c2*1-4(14)12-7-5(15)2-11(20, 10(18)19)21-9(7)8(17)6(16)3-13;/h2*5-9, 15-17, 20H, 2-3H2, 1H3, (H, 12, 14)(H, 18, 19);/q2*-1;+2/t2*5-, 6+, 7+, 8+, 9+, 11-;/m00./s1/f/h2*12, 18H; potassium hydrogen tartrate | InChI=1/C4H6O6.K/c5-1(3(7)8)2(6)4(9)10;/h1-2, 5-6H, (H, 7, 8)(H, 9, 10);/q;+1/p-1/t1-, 2-;/m1./s1/fC4H5O6.K/h7H;/q-1;m
barium N-acetylneuraminate | InChI=1/2C11H18NO9.Ba/c2*1-4(14)12-7-5(15)2-11(20, 10(18)19)21-9(7)8(17)6(16)3-13;/h2*5-9, 15-17, 20H, 2-3H2, 1H3, (H, 12, 14)(H, 18, 19);/q2*-1;+2/t2*5-, 6+, 7+, 8+, 9+, 11-;/m00./s1/f/h2*12, 18H; potassium hydrogen tartrate | InChI=1/C4H6O6.K/c5-1(3(7)8)2(6)4(9)10;/h1-2, 5-6H, (H, 7, 8)(H, 9, 10);/q;+1/p-1/t1-, 2-;/m1./s1/fC4H5O6.K/h7H;/q-1;m

Random Queries

boiling point of cobalt dichloride
H2SO4 + O2 + Cr = H2O + Cr2(SO4)3
(1, 1-dimethylbutyl)benzene
(name of titanium(IV) cation)/(net ionic charge of titanium(IV) cation)
CAS number of acetyl-1-13 C-L-carnitine hydrochloride
Zn + FeCl2 = Fe + ZnCl2
formula of cesium iodide
InChI identifier of scopolamine
InChI identifier of nickel perchlorate vs rubidium tetraphenylborate
Hill formula string of beryllium vs thulium(III) nitrate