Search

name of cesium chlorate

Input interpretation

cesium chlorate
cesium chlorate

Chemical names and formulas

formula | CsClO_3 Hill formula | ClCsO_3 name | cesium chlorate mass fractions | Cl (chlorine) 16.4% | Cs (cesium) 61.4% | O (oxygen) 22.2%
formula | CsClO_3 Hill formula | ClCsO_3 name | cesium chlorate mass fractions | Cl (chlorine) 16.4% | Cs (cesium) 61.4% | O (oxygen) 22.2%

Structure diagram

Structure diagram
Structure diagram
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

molar mass | 216.35 g/mol
molar mass | 216.35 g/mol

Units

Chemical identifiers

PubChem CID number | 23685553 SMILES identifier | [O-]Cl(=O)=O.[Cs+] InChI identifier | InChI=1/ClHO3.Cs/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Cs/q-1;m
PubChem CID number | 23685553 SMILES identifier | [O-]Cl(=O)=O.[Cs+] InChI identifier | InChI=1/ClHO3.Cs/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Cs/q-1;m

Random Queries

van der Waals radius ruthenium
molar mass of iodine(I) cation vs chlorine(VI) cation
name of xenon(VIII) cation vs bromide anion
molar mass of magnesium sulfide vs scandium(III) bromide hydrate
cation anion
electronegativity of magnesium
discovery year of group 9 elements
decomposition point of cesium perchlorate vs lead(II) nitrate
density of nickel vs copper
chemical types of calcium phosphide vs tin(II) pyrophosphate