Search

name of cesium chlorate

Input interpretation

cesium chlorate
cesium chlorate

Chemical names and formulas

formula | CsClO_3 Hill formula | ClCsO_3 name | cesium chlorate mass fractions | Cl (chlorine) 16.4% | Cs (cesium) 61.4% | O (oxygen) 22.2%
formula | CsClO_3 Hill formula | ClCsO_3 name | cesium chlorate mass fractions | Cl (chlorine) 16.4% | Cs (cesium) 61.4% | O (oxygen) 22.2%

Structure diagram

Structure diagram
Structure diagram
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

molar mass | 216.35 g/mol
molar mass | 216.35 g/mol

Units

Chemical identifiers

PubChem CID number | 23685553 SMILES identifier | [O-]Cl(=O)=O.[Cs+] InChI identifier | InChI=1/ClHO3.Cs/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Cs/q-1;m
PubChem CID number | 23685553 SMILES identifier | [O-]Cl(=O)=O.[Cs+] InChI identifier | InChI=1/ClHO3.Cs/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Cs/q-1;m

Random Queries

InChI identifier of nitric-15 noxide-18 O
alternate names of mercury(I) chloride vs lithium hydroxide monohydrate
formula of platinum(IV) oxide vs iron(III) oxide
HNO3 + Zn = H2O + NO2 + NH4NO3 + Zn(NO3)2
alternate names of potassium silver cyanide
name of acuminite vs boleite
formula of ozone vs tungsten(VI) fluoride
molar mass of tetrabromobisphenol A
melting point of 2'-deoxyinosine
PubChem SID number of tungsten carbide