Search

SMILES identifier of 2,3,7,8,12,13,17,18-octaethyl-21H,23 H-porphine copper(II)

Input interpretation

2, 3, 7, 8, 12, 13, 17, 18-octaethyl-21H, 23 H-porphine copper(II) | SMILES identifier
2, 3, 7, 8, 12, 13, 17, 18-octaethyl-21H, 23 H-porphine copper(II) | SMILES identifier

Result

CCC1=C(CC)C2=CC3=NC(=CC4=C(CC)C(=C(C=C5C(=C(CC)C(=N5)C=C1N2)CC)N4)CC)C(=C3CC)CC.[Cu+2]
CCC1=C(CC)C2=CC3=NC(=CC4=C(CC)C(=C(C=C5C(=C(CC)C(=N5)C=C1N2)CC)N4)CC)C(=C3CC)CC.[Cu+2]

Random Queries

I2 + Al = AlI
formula of chlorate anion vs phosphate anion
glycerol vs 3,5-bis(trifluoromethyl)phenyl isothiocyanate
add deuteranopia color blindness filter to a picture of a natrojarosite
Curie point of dying low mass star elements
MDL number of sulfur trioxide
color of boron vs fluorine
NFPA label of iron(III) bromide
freezing point of thallous nitrate vs sodium sulfide
stannous chloride