Input interpretation
tetralin | 1, 4-diethynylbenzene
Chemical names and formulas
| tetralin | 1, 4-diethynylbenzene formula | C_10H_12 | HC congruent CC_6H_4C congruent CH Hill formula | C_10H_12 | C_10H_6 name | tetralin | 1, 4-diethynylbenzene IUPAC name | tetralin | 1, 4-diethynylbenzene alternate names | 1, 2, 3, 4-tetrahydronaphthalene | tetrahydronaphthalene | tetralina | tetraline | Tetralin®solvent | tetranap | (none) mass fractions | C (carbon) 90.9% | H (hydrogen) 9.15% | C (carbon) 95.2% | H (hydrogen) 4.79%
Structure diagrams
| tetralin | 1, 4-diethynylbenzene vertex count | 10 | 10 edge count | 11 | 10 Schultz index | 520 | 516 Wiener index | 109 | 125 Hosoya index | 148 | 108 Balaban index | 1.925 | 2.174
3D structure
3D structure
Basic properties
| tetralin | 1, 4-diethynylbenzene molar mass | 132.21 g/mol | 126.16 g/mol phase | liquid (at STP) | solid (at STP) melting point | -35 °C | 96 °C boiling point | 207 °C | density | 0.973 g/cm^3 | solubility in water | insoluble |
Units
Liquid properties
| tetralin density | 0.973 g/cm^3 vapor pressure | 0.18 mmHg dynamic viscosity | 0.002012 Pa s surface tension | 0.0355 N/m refractive index | 1.541
Units
Thermodynamic properties
| tetralin molar heat of vaporization | 41.3 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.312 kJ/g (kilojoules per gram) molar heat of combustion | 5665 kJ/mol (kilojoules per mole) molar heat of fusion | 12.5 kJ/mol (kilojoules per mole) critical temperature | 707 K (kelvins) critical pressure | 3.57 MPa (megapascals) acentric factor ω | 0.4
Chemical identifiers
| tetralin | 1, 4-diethynylbenzene CAS number | 119-64-2 | 935-14-8 Beilstein number | 1446407 | PubChem CID number | 8404 | 120463 PubChem SID number | | 24882477 SMILES identifier | C1CCC2=CC=CC=C2C1 | C#CC1=CC=C(C=C1)C#C InChI identifier | InChI=1/C10H12/c1-2-6-10-8-4-3-7-9(10)5-1/h1-2, 5-6H, 3-4, 7-8H2 | InChI=1/C10H6/c1-3-9-5-7-10(4-2)8-6-9/h1-2, 5-8H RTECS number | QK3850000 | CZ5643000 MDL number | MFCD00001733 | MFCD00078375