Search

SMILES identifier of ethyl 2-(2-tritylaminothiazole-4-yl)-2-hydroxyiminoacetate hydrochloride

Input interpretation

ethyl 2-(2-tritylaminothiazole-4-yl)-2-hydroxyiminoacetate hydrogen chloride | SMILES identifier
ethyl 2-(2-tritylaminothiazole-4-yl)-2-hydroxyiminoacetate hydrogen chloride | SMILES identifier

Results

ethyl 2-(2-tritylaminothiazole-4-yl)-2-hydroxyiminoacetate | CCOC(=O)C(=NO)C1=CSC(=N1)NC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 hydrogen chloride | Cl
ethyl 2-(2-tritylaminothiazole-4-yl)-2-hydroxyiminoacetate | CCOC(=O)C(=NO)C1=CSC(=N1)NC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 hydrogen chloride | Cl

Random Queries

formula of zirconium(IV) cation vs palladium(II) cation
DrugBank number of acetaminophen
formula string of propionic acid vs 10-hydroxynerol
aluminum vs tin vs indium
alternate names of cerium vs terbium
IUPAC name of potassium cuprocyanide vs thallium(I) acetylacetonate
CAS deuterium hydride
(DOT numbers of malonaldehyde)/(name of malonaldehyde)
density of ethylene glycol
chemical types of calcium iodide vs 3'-iodo-4'-methoxyacetophenone