name of tetradecahydrophenanthrene

tetradecahydrophenanthrene

formula | C_14H_24 name | tetradecahydrophenanthrene IUPAC name | 1, 2, 3, 4, 4a, 4b, 5, 6, 7, 8, 8a, 9, 10, 10a-tetradecahydrophenanthrene alternate names | perhydrophenanthrene | phenanthrene, tetradecahydro- | tricyclo[8.4.0.0(2, 7)]tetradecane mass fractions | C (carbon) 87.4% | H (hydrogen) 12.6%

Draw the Lewis structure of tetradecahydrophenanthrene. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4) and hydrogen (n_H, val = 1) atoms: 14 n_C, val + 24 n_H, val = 80 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8) and hydrogen (n_H, full = 2): 14 n_C, full + 24 n_H, full = 160 Subtracting these two numbers shows that 160 - 80 = 80 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 40 bonds and hence 80 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 80 - 80 = 0 electrons left to draw and the diagram is complete: Answer: | |

3D structure

molar mass | 192.35 g/mol phase | liquid (at STP) melting point | 13 °C boiling point | 272 °C density | 0.933 g/cm^3 solubility in water | insoluble

density | 0.933 g/cm^3 vapor pressure | 62.2 mmHg (at 181.5 °C) dynamic viscosity | 0.00797 Pa s (at 20 °C) refractive index | 1.5152

CAS number | 5743-97-5 Beilstein number | 2038162 PubChem CID number | 21971 SMILES identifier | C1CCC2C(C1)CCC3C2CCCC3 InChI identifier | InChI=1/C14H24/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h11-14H, 1-10H2 EU number | 227-267-8 NSC number | 91521