Input interpretation
dichlorine heptoxide
Chemical names and formulas
formula | Cl_2O_7 name | dichlorine heptoxide IUPAC name | perchloryl perchlorate alternate names | perchloric anhydride | chlorine heptaoxide | CASNumber->CAS10294-48-1 mass fractions | Cl (chlorine) 38.8% | O (oxygen) 61.2%
Lewis structure
Draw the Lewis structure of dichlorine heptoxide. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the chlorine (n_Cl, val = 7) and oxygen (n_O, val = 6) atoms: 2 n_Cl, val + 7 n_O, val = 56 Calculate the number of electrons needed to completely fill the valence shells for chlorine (n_Cl, full = 8) and oxygen (n_O, full = 8): 2 n_Cl, full + 7 n_O, full = 72 Subtracting these two numbers shows that 72 - 56 = 16 bonding electrons are needed. Each bond has two electrons, so we expect that the above diagram has all the necessary bonds. However, to minimize formal charge oxygen wants 2 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: In order to minimize their formal charge, atoms with large electronegativities can force atoms with smaller electronegativities on period 3 or higher to expand their valence shells. The electronegativities of the atoms are 3.16 (chlorine) and 3.44 (oxygen). Because the electronegativity of chlorine is smaller than the electronegativity of oxygen and the electronegativity of {} is smaller than the electronegativity of {}, expand the valence shell of chlorine to 7 bonds in 2 places and expand the valence shell of {} to {} bonds. Therefore we add a total of 6 bonds to the diagram: Answer: | |
Basic properties
molar mass | 182.9 g/mol melting point | -91.5 °C boiling point | 82 °C density | 1.9 g/cm^3 solubility in water | reacts
Units
Chemical identifiers
CAS number | 10294-48-1 PubChem CID number | 123272 SMILES identifier | O=Cl(=O)(=O)OCl(=O)(=O)=O