Search

InChI identifier of tetradecanoyl chloride

Input interpretation

tetradecanoyl chloride | InChI identifier
tetradecanoyl chloride | InChI identifier

Result

InChI=1/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2, 1H3
InChI=1/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2, 1H3

Random Queries

ion class of hydride anion
name of boron anion vs hexafluorophosphate
ions bismuth(III) nitrate pentahydrate
formula of cobalt(II) chloride hexahydrate vs terbium(III) sulfate
hydrogen, silver, I
CAS number of selenic acid vs rhenium(VI) dioxydifluoride
5H2O = H2O + Cu + ZnSO4
empirical formula of tetrahydrofuran
Cl2 + Fe = FeCl2
CaO + HF = H2O + CaF2