Search

InChI identifier of tetradecanoyl chloride

Input interpretation

tetradecanoyl chloride | InChI identifier
tetradecanoyl chloride | InChI identifier

Result

InChI=1/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2, 1H3
InChI=1/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2, 1H3

Random Queries

NFPA reactivity rating of NOx compounds
number of valence electrons of semiconductors
density of kadyrelite vs nantokite
molar mass of phosphite anion
formula string of chromium(VI) ions
hydrogen carbonate anion vs copper(II) cation vs iodide anion
HNO3 + Mn(NO3)2 + KBiO3 = H2O + KMnO4 + KNO3 + Bi(NO3)3
(freezing point of 1,3-butadiene)/(boiling point of 1,3-butadiene)
mass fractions of bismuth chloride
molar mass of antimonide(3-) anion