Input interpretation
styrene oxide
Chemical names and formulas
formula | C_8H_8O name | styrene oxide IUPAC name | 2-phenyloxirane alternate names | 1, 2-epoxyethylbenzene | 2-phenyloxirane | epoxystyrene | phenylethylene oxide | phenyloxirane | styrene epoxide | styryl oxide mass fractions | C (carbon) 80% | H (hydrogen) 6.71% | O (oxygen) 13.3%
Lewis structure
Draw the Lewis structure of styrene oxide. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 8 n_C, val + 8 n_H, val + n_O, val = 46 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 8 n_C, full + 8 n_H, full + n_O, full = 88 Subtracting these two numbers shows that 88 - 46 = 42 bonding electrons are needed. Each bond has two electrons, so in addition to the 18 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 120.15 g/mol phase | liquid (at STP) melting point | -37 °C boiling point | 194 °C density | 1.054 g/cm^3 solubility in water | slightly soluble
Units
Liquid properties (at STP)
density | 1.054 g/cm^3 vapor pressure | 0.9998 mmHg dynamic viscosity | 0.00199 Pa s (at 20 °C) refractive index | 1.535
Units
Chemical identifiers
CAS number | 96-09-3 Beilstein number | 108582 PubChem CID number | 7276 PubChem SID number | 24899628 SMILES identifier | C1C(O1)C2=CC=CC=C2 InChI identifier | InChI=1/C8H8O/c1-2-4-7(5-3-1)8-6-9-8/h1-5, 8H, 6H2 RTECS number | CZ9625000 MDL number | MFCD00005121
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 2 NFPA reactivity rating | 0
Safety properties
flash point | 79.44 °C autoignition point | 435 °C lower explosive limit | 1.1% (concentration in air) upper explosive limit | 22% (concentration in air)
DOT hazard class | 3 DOT numbers | 2436
Toxicity properties
RTECS classes | tumorigen | mutagen | reproductive effector