Search

SMILES identifier of phenethylmagnesium chloride

Input interpretation

phenethylmagnesium chloride | SMILES identifier
phenethylmagnesium chloride | SMILES identifier

Result

[CH2-]CC1=CC=CC=C1.[Mg+2].[Cl-]
[CH2-]CC1=CC=CC=C1.[Mg+2].[Cl-]

Random Queries

(1, 1-dimethylbutyl)benzene
atomic mass of roentgenium vs lawrencium
tungsten(VI) cation
ion class of yttrium(III) cation vs chromium(III) cation
molar mass of copper(I) mercury iodide
net ionic charge of nitrite anion vs chromium(III) cation
S + KClO = SO2 + KCl
empirical formula of antimony pentoxide
name of iridium(V) cation vs iridium(II) cation
(covalent radius of argon)/(nuclear diameter of argon)