Search

SMILES identifier of acetoxime vs colchicine

Input interpretation

acetoxime colchicine | SMILES identifier
acetoxime colchicine | SMILES identifier

Results

acetoxime | CC(=NO)C colchicine | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC
acetoxime | CC(=NO)C colchicine | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC

Random Queries

alternate names of sodium metatungstate hydrate
formulas of polar aprotic solvents
density of phosphorus vs fluorine
ion class of fluoride anion vs tin(IV) cation
name of sodium formate vs lithium hydroxide monohydrate
name of lutetium(III) cation vs neodymium(III) cation
formula of stannate anion
alternate names of trimethylamine vs hydrogen cyanide
boiling point of manganese vs nickel
formula of potassium hexabromoiridate(IV) vs zinc sulfate heptahydrate