Search

InChI identifier of 4-methylbenzylmagnesium chloride

Input interpretation

4-methylbenzylmagnesium chloride | InChI identifier
4-methylbenzylmagnesium chloride | InChI identifier

Result

InChI=1/C8H9.ClH.Mg/c1-7-3-5-8(2)6-4-7;;/h3-6H, 1H2, 2H3;1H;/q-1;;+2/p-1/fC8H9.Cl.Mg/h;1h;/qm;-1;m
InChI=1/C8H9.ClH.Mg/c1-7-3-5-8(2)6-4-7;;/h3-6H, 1H2, 2H3;1H;/q-1;;+2/p-1/fC8H9.Cl.Mg/h;1h;/qm;-1;m

Random Queries

name of palladium(I) cation
O2 + CH4 = H2O + CO2
CAS number of hydrogen vs calcium
molar mass of thallium(II) cation vs fluoride anion
Hill formula of lead(II) styphnate
name of manganese vs europium(III) acetate hydrate
sodium
name of phosphate anion vs phosphite anion
atomic radius of calcium vs zinc
chemical types stannic chloride pentahydrate