Search

InChI identifier of 4-methylbenzylmagnesium chloride

Input interpretation

4-methylbenzylmagnesium chloride | InChI identifier
4-methylbenzylmagnesium chloride | InChI identifier

Result

InChI=1/C8H9.ClH.Mg/c1-7-3-5-8(2)6-4-7;;/h3-6H, 1H2, 2H3;1H;/q-1;;+2/p-1/fC8H9.Cl.Mg/h;1h;/qm;-1;m
InChI=1/C8H9.ClH.Mg/c1-7-3-5-8(2)6-4-7;;/h3-6H, 1H2, 2H3;1H;/q-1;;+2/p-1/fC8H9.Cl.Mg/h;1h;/qm;-1;m

Random Queries

melting point of uranium vs thorium
melting point of tin(IV) iodide
H2SO4 + Cu + KNO3 = H2O + K2SO4 + NO + CuSO4
InChI identifier of β-D-fructopyranose
zinc vs germanium vs gallium
molar mass of antimony oxide vs iridium(III) chloride hydrate
resistivity of chlorine
Al-31 vs Pb-211
alternate names of potassium peroxide vs sodium tungstate
chemical types of 1-phenylcyclohexene