Search

( strontium hexaboride)

Input interpretation

strontium hexaboride
strontium hexaboride

Chemical names and formulas

formula | SrB_6 Hill formula | B_6Sr name | strontium hexaboride mass fractions | B (boron) 42.5% | Sr (strontium) 57.5%
formula | SrB_6 Hill formula | B_6Sr name | strontium hexaboride mass fractions | B (boron) 42.5% | Sr (strontium) 57.5%

Structure diagram

Structure diagram
Structure diagram
vertex count | 7 edge count | 8 Schultz index | 164 Wiener index | 23 Hosoya index | 25 Balaban index | 2.151
vertex count | 7 edge count | 8 Schultz index | 164 Wiener index | 23 Hosoya index | 25 Balaban index | 2.151

Basic properties

molar mass | 152.5 g/mol density | 3.39 g/cm^3
molar mass | 152.5 g/mol density | 3.39 g/cm^3

Units

Chemical identifiers

CAS number | 12046-54-7 PubChem CID number | 16212527 PubChem SID number | 24864614 SMILES identifier | [B-]1B2B1B3B2[B-]3.[Sr+2] InChI identifier | InChI=1/B6.Sr/c1-3-4(1)6-2-5(3)6;/q-2;+2 MDL number | MFCD01310211
CAS number | 12046-54-7 PubChem CID number | 16212527 PubChem SID number | 24864614 SMILES identifier | [B-]1B2B1B3B2[B-]3.[Sr+2] InChI identifier | InChI=1/B6.Sr/c1-3-4(1)6-2-5(3)6;/q-2;+2 MDL number | MFCD01310211

Random Queries

price of silver vs iron
Fe + SCN = FeSCN
relative molecular mass of scandium sulfide
alternate names of indium(III) cation vs cobalt(II) cation
specific gravity of beryllium
ion electron configuration of cobalt(III) ions
melting point behavior of heavy molecule
formula of L-serine
PubChem CID number of hexarhodium(0) hexadecacarbonyl
DOT numbers of potassium chromate vs chromium