Search

InChI identifier of sucrose

Input interpretation

sucrose | InChI identifier
sucrose | InChI identifier

Result

InChI=1/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11, 13-20H, 1-3H2/t4-, 5-, 6-, 7-, 8+, 9+, 10+, 11-, 12+/m1/s1
InChI=1/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11, 13-20H, 1-3H2/t4-, 5-, 6-, 7-, 8+, 9+, 10+, 11-, 12+/m1/s1

Random Queries

molar mass of mercury
H2SO4 + KOH = H2O + K2(SO4)
H2S + K2Cr2O7 + H3PO4 = H2O + K3PO4 + S8 + CrPO4
molar mass of cyanide anion vs dimercury(I) cation
edge types of polythiazide vs 2,6-difluorobenzoic acid
ion electron configuration of iodine(I) cation vs bromine(IV) cation
IUPAC name of chromium picolinate
molar mass of osmium(IV) oxide
DOT numbers of chlorine pentafluoride vs methyl vinyl ether
NaBr + NH4OH = NaOH + NH4Br